CAS 1724-02-3
:glutaconic acid
Description:
Glutaconic acid, also known as 3-pentenedioic acid, is a dicarboxylic acid characterized by its two carboxyl functional groups (-COOH) and a double bond between the second and third carbon atoms in its five-carbon chain. This structure imparts unique properties, including its ability to participate in various chemical reactions such as esterification and polymerization. Glutaconic acid is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in water and organic solvents, making it versatile for various applications in organic synthesis and biochemistry. The compound is of interest in the study of metabolic pathways, particularly in relation to amino acid metabolism. Additionally, glutaconic acid can serve as a precursor for the synthesis of other chemical compounds, including pharmaceuticals and agrochemicals. Its derivatives may exhibit biological activity, contributing to its relevance in research and industrial applications. Safety data indicates that, like many organic acids, it should be handled with care to avoid irritation or adverse reactions.
Formula:C5H6O4
InChI:InChI=1/C5H6O4/c6-4(7)2-1-3-5(8)9/h1-2H,3H2,(H,6,7)(H,8,9)/b2-1+
InChI key:InChIKey=XVOUMQNXTGKGMA-UHFFFAOYSA-N
SMILES:C(CC(O)=O)=CC(O)=O
Synonyms:- (2E)-pent-2-enedioic acid
- 1,3-Propenedicarboxylic acid
- 1-Propene-1,3-dicarboxylic acid
- 2-Pentenedioic acid
- Pent-2-Ene-1,5-Dioic Acid
- Pent-2-Enedioic Acid
- Pentenedioic acid
- Glutaconic acid
- pentene diacid
- TRANS-GLUTACONIC ACID
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Glutaconic Acid
CAS:Controlled Product<p>Applications Glutaconic Acid is used in the synthesis of dialkyltin derivatives of dicarboxylic acids which display antitumor properties. Also used in the synthesis of novel tetracyclic compounds as peripheral benzodiazepine receptor ligands with potential use for CNS illness treatments.<br>References Gielen, M. et al.: Hetero. Chem., 3, 449 (1992); Okubo, T. et al.: Bioorg. Med. Chem. Lett., 12, 3569 (2004);<br></p>Formula:C5H6O4Color and Shape:NeatMolecular weight:130.1Glutaconic acid
CAS:Glutaconic acid is a carboxylic acid that inhibits the production of malonic acid by inhibiting the activity of the enzyme succinate dehydrogenase. This inhibition leads to the accumulation of ethylmalonic acid, which can be detected in urine. Glutaconic acid is used as a diagnostic test for diseases such as diabetic neuropathy and infectious diseases such as malaria. It also has inhibitory properties on glutamate-induced neuronal death, making it a potential therapeutic agent for conditions such as amyotrophic lateral sclerosis and Parkinson's disease.Formula:C5H6O4Purity:Min. 95%Molecular weight:130.1 g/mol
