CAS 1724-17-0
:Methyl oleanolate
Description:
Methyl oleanolate is a triterpenoid compound derived from oleanolic acid, characterized by its chemical structure that includes a methyl ester functional group. It is typically found in various plants, particularly in the family of Oleaceae, and is known for its potential pharmacological properties. Methyl oleanolate exhibits anti-inflammatory, antioxidant, and hepatoprotective activities, making it of interest in medicinal chemistry and natural product research. The compound is generally a white to pale yellow solid with low solubility in water but is soluble in organic solvents such as ethanol and chloroform. Its molecular formula reflects a complex arrangement of carbon, hydrogen, and oxygen atoms, contributing to its diverse biological activities. Methyl oleanolate is often studied for its potential therapeutic applications, including its role in traditional medicine and its effects on various biological pathways. As with many natural compounds, further research is necessary to fully elucidate its mechanisms of action and potential benefits in health and disease.
Formula:C31H50O3
InChI:InChI=1S/C31H50O3/c1-26(2)15-17-31(25(33)34-8)18-16-29(6)20(21(31)19-26)9-10-23-28(5)13-12-24(32)27(3,4)22(28)11-14-30(23,29)7/h9,21-24,32H,10-19H2,1-8H3/t21-,22-,23+,24-,28-,29+,30+,31-/m0/s1
InChI key:InChIKey=BTXWOKJOAGWCSN-JBYJGCOVSA-N
SMILES:C(OC)(=O)[C@]12[C@](C=3[C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)(C(C)(C)[C@@H](O)CC5)[H])[H])(CC(C)(C)CC2)[H]
Synonyms:- Methyl (3beta)-3-hydroxyolean-12-en-28-oate
- Methyl 3β-hydroxyolean-12-en-28-oate
- Methyl oleanate
- Methyl oleanolate
- Olean-12-en-28-oic acid, 3-hydroxy-, methyl ester, (3beta)-
- Olean-12-en-28-oic acid, 3-hydroxy-, methyl ester, (3β)-
- Olean-12-en-28-oic acid, 3β-hydroxy-, methyl ester
- Oleanolic acid methyl ester
- Virgaureagenin B methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Oleanolic acid methylester
CAS:Oleanolic acid methylester analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C31H50O3Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:470.74Methyl (3β) 3-Hydroxyolean-12-en-28-oate
CAS:Formula:C31H50O3Purity:95%Color and Shape:SolidMolecular weight:470.7269Methyl oleanolate
CAS:Methyl oleanolate is a natural product.Formula:C31H50O3Purity:97.95%Color and Shape:SolidMolecular weight:470.73Oleanolic acid methyl ester
CAS:Controlled ProductOleanolic acid methyl ester is a methylated derivative of oleanolic acid, which is a pentacyclic triterpenoid. It is derived from various plant sources, such as olive oil and other medicinal herbs. Oleanolic acid is widely encountered in the plant kingdom and the methyl ester is utilized to enhance its solubility and stability in diverse biochemical environments.
Formula:C31H50O3Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:470.73 g/mol



