CAS 1724-18-1

Benzo[3,4]-18-norpregna-3,5,17(20)-triene-3(2′H)-carboxylic acid, 3′,4′,5′,6′-tetrahydro-4′,4′,9,14,20-pentamethyl-, methyl ester, (3β,4β,8α,9β,10α,13α,14β)-

Description:

Benzo[3,4]-18-norpregna-3,5,17(20)-triene-3(2′H)-carboxylic acid, 3′,4′,5′,6′-tetrahydro-4′,4′,9,14,20-pentamethyl-, methyl ester, with the CAS number 1724-18-1, is a synthetic steroid compound characterized by its complex polycyclic structure, which includes a steroid backbone with multiple methyl groups and a benzo ring. This compound is typically used in research settings, particularly in studies related to steroid chemistry and pharmacology. Its structural features suggest potential biological activity, possibly influencing hormonal pathways or exhibiting anti-inflammatory properties. The presence of the carboxylic acid moiety and the methyl ester indicates that it may undergo hydrolysis, leading to the release of the active acid form. Additionally, the stereochemistry of the compound, denoted by the specific configuration at various chiral centers, is crucial for its biological activity and interaction with receptors. Overall, this compound exemplifies the intricate nature of steroid derivatives and their potential applications in medicinal chemistry.

Formula: C₃₁H₄₈O₂

InChI: InChI=1S/C31H48O2/c1-20(2)21-11-13-28(5)22(21)12-14-30(7)25(28)10-9-23-24-19-27(3,4)15-17-31(24,26(32)33-8)18-16-29(23,30)6/h9,22,24-25H,10-19H2,1-8H3/t22-,24-,25+,28-,29+,30+,31-/m0/s1

InChI key: InChIKey=IOPWKRLDGMBGCA-BUESHWSCSA-N

SMILES: C(OC)(=O)[C@]12[C@](C=3[C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)(C(=C(C)C)CC5)[H])[H])(CC(C)(C)CC2)[H]

Synonyms:

• 1H-Cyclopenta[a]chrysene, A-neooleana-3,12-dien-20-oic acid deriv.
• A-Neooleana-3,12-dien-28-oic acid, methyl ester
• Benzo[3,4]-18-norpregna-3,5,17(20)-triene-3(2′H)-carboxylic acid, 3′,4′,5′,6′-tetrahydro-4′,4′,9,14,20-pentamethyl-, methyl ester, (3β,4β,8α,9β,10α,13α,14β)-

Oleanolic acid derivative 1

CAS: 1724-18-1

Oleanolic acid derivative 1 is an oleanolic acid derivative.

Formula: C₃₁H₄₈O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 452.71

Ref: TM-T19494