CAS 17240-33-4

6-methoxyimidazo[1,2-b]pyridazine

Description:

6-Methoxyimidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its fused imidazole and pyridazine rings, with a methoxy group attached at the 6-position. This compound typically exhibits a pale to light-colored appearance and is soluble in organic solvents, reflecting its aromatic nature. The presence of the methoxy group enhances its lipophilicity, potentially influencing its biological activity and interaction with various receptors or enzymes. As a member of the imidazo-pyridazine family, it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's structure allows for various substitution patterns, which can affect its reactivity and stability. Additionally, it may participate in hydrogen bonding due to the nitrogen atoms in its rings, contributing to its potential applications in drug design and development. Overall, 6-methoxyimidazo[1,2-b]pyridazine represents a versatile scaffold for further exploration in chemical and pharmaceutical research.

Formula: C₇H₇N₃O

InChI: InChI=1/C7H7N3O/c1-11-7-3-2-6-8-4-5-10(6)9-7/h2-5H,1H3

SMILES: COc1ccc2nccn2n1

6-Methoxy-imidazo[1,2-b]pyridazine

CAS: 17240-33-4

6-Methoxy-imidazo[1,2-b]pyridazine

Purity: 95%

Molecular weight: 149.15g/mol

Ref: 54-OR942662