CAS 17245-25-9
:5,7-dimethoxy-8-(3-methylbut-2-en-1-yl)-2H-chromen-2-one
Description:
5,7-Dimethoxy-8-(3-methylbut-2-en-1-yl)-2H-chromen-2-one, with the CAS number 17245-25-9, is a chemical compound belonging to the class of flavonoids, specifically a type of chromone. This compound features a chromenone backbone, characterized by a benzopyran structure with a carbonyl group at the 2-position. The presence of methoxy groups at the 5 and 7 positions enhances its solubility and may influence its biological activity. The 8-position is substituted with a 3-methylbut-2-en-1-yl group, which contributes to its structural complexity and potential reactivity. This compound may exhibit various biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in pharmacological research. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many flavonoids, its properties can be influenced by factors such as pH, solvent, and temperature, which are important considerations in experimental settings.
Formula:C16H18O4
InChI:InChI=1/C16H18O4/c1-10(2)5-6-11-13(18-3)9-14(19-4)12-7-8-15(17)20-16(11)12/h5,7-9H,6H2,1-4H3
SMILES:CC(=CCc1c(cc(c2ccc(=O)oc12)OC)OC)C
Synonyms:- 5,7-Dimethoxy-8-(3-methyl-2-butenyl)coumarin
- 5,7-Dimethoxy-8-(3-methyl-2-butenyl)-2H-1-benzopyran-2-one
- 5,7-dimethoxy-8-(3-methylbut-2-enyl)chromen-2-one
- 2H-1-Benzopyran-2-one,5,7-dimethoxy-8-(3-methyl-2-buten-1-yl)-
- Coumurrayin
- 5-methoxy-osthol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Coumurrayin
CAS:Coumurrayin may have anticoagulant activity.Formula:C16H18O4Purity:98%Color and Shape:SolidMolecular weight:274.31Coumurrayin
CAS:Coumurrayin is a naturally occurring phytochemical compound, which is derived from plant sources, particularly from the Murraya genus. It acts primarily as a bioactive agent through various biochemical pathways, including the inhibition of specific enzyme activities, and the modulation of cellular signaling processes. These actions suggest its involvement in anti-inflammatory and antioxidant defenses, although the exact mechanisms remain to be fully elucidated.Formula:C16H18O4Purity:Min. 95%Molecular weight:274.31 g/mol




