
CAS 17249-00-2
:Laccaic acid B
Description:
Laccaic acid B, with the CAS number 17249-00-2, is a natural compound primarily derived from the lac insect, which is known for producing lac resin. This substance is classified as a polyphenolic compound and is part of a larger group of laccaic acids, which are characterized by their complex structures and potential biological activities. Laccaic acid B exhibits antioxidant properties, which may contribute to its utility in various applications, including cosmetics and food preservation. The compound is typically soluble in organic solvents but has limited solubility in water, reflecting its hydrophobic nature. Its molecular structure includes multiple hydroxyl groups, which are responsible for its reactivity and interaction with other molecules. Additionally, laccaic acid B has been studied for its potential antimicrobial properties, making it of interest in both pharmaceutical and agricultural contexts. Overall, laccaic acid B represents a fascinating example of a natural product with diverse applications and significant biochemical properties.
Formula:C24H16O12
InChI:InChI=1S/C24H16O12/c25-4-3-7-1-2-10(26)8(5-7)13-20(30)17-16(22(32)21(13)31)18(28)9-6-11(27)14(23(33)34)15(24(35)36)12(9)19(17)29/h1-2,5-6,25-27,30-32H,3-4H2,(H,33,34)(H,35,36)
InChI key:InChIKey=BVLPXKYBBOURAF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(C(=O)C=3C(C2=O)=C(O)C(=C(O)C3O)C4=CC(CCO)=CC=C4O)=CC(O)=C1C(O)=O
Synonyms:- 1,2-Anthracenedicarboxylic acid, 9,10-dihydro-3,5,6,8-tetrahydroxy-7-[2-hydroxy-5-(2-hydroxyethyl)phenyl]-9,10-dioxo-
- Laccaic acid B
- 9,10-Dihydro-3,5,6,8-tetrahydroxy-7-[2-hydroxy-5-(2-hydroxyethyl)phenyl]-9,10-dioxo-1,2-anthracenedicarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Laccaic acid B
CAS:Laccaic acid B is a bioactive chemical.Formula:C24H16O12Color and Shape:SolidMolecular weight:496.38
