CAS 17249-79-5
:2,3-Dichlorothiophene
Description:
2,3-Dichlorothiophene is a heterocyclic organic compound characterized by a five-membered ring containing both sulfur and chlorine substituents. It features a thiophene ring, which is a cyclic compound with four carbon atoms and one sulfur atom, and in this case, two chlorine atoms are attached to the 2 and 3 positions of the ring. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its reactivity, particularly in electrophilic substitution reactions due to the presence of the electron-withdrawing chlorine atoms, which can influence the electronic properties of the thiophene ring. 2,3-Dichlorothiophene is utilized in various chemical syntheses and may serve as an intermediate in the production of agrochemicals, pharmaceuticals, and other organic compounds. Its physical properties, such as boiling point and solubility, can vary based on environmental conditions and purity. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C4H2Cl2S
InChI:InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H
SMILES:c1csc(c1Cl)Cl
Synonyms:- 2,3-Dichloro-Thiophene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3-Dichlorothiophene
CAS:2,3-Dichlorothiophene is a heterocyclic compound that can be used as an intermediate in organic synthesis. The compound has two isomers, 2,2-dichlorothiophene and 2,3-dichlorothiophene. The first isomer reacts with water to form a protonated species and the second isomer reacts with chlorine to form a protonated species. The thermodynamic parameters for the reaction of 2,3-dichlorothiophene with chlorine are more favorable than those for the reaction of 2,2-dichlorothiophene with chlorine. This means that the equilibrium lies to the right when 2,3-chlorothiophene is reacted with chlorine (to form 2,3-dichloroethane), but not when 2,2-chlorothiophene is reacted with chlorine (to form chloroform).
Formula:C4H2Cl2SPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:153.03 g/mol



