CAS 172516-32-4

ethyl 3-(allylthio)-4-oxo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate

Description:

Ethyl 3-(allylthio)-4-oxo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate, with the CAS number 172516-32-4, is a chemical compound that features a complex structure characterized by a benzo[c]thiophene core. This compound contains a tetrahydro configuration, indicating the presence of a saturated ring system, and incorporates an allylthio group, which suggests potential reactivity and applications in organic synthesis. The presence of a carboxylate ester functional group (ethyl ester) indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid. The oxo group implies that there is a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic additions. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its unique structural features may also contribute to its potential as a building block in the synthesis of more complex molecules. Overall, the characteristics of this compound suggest versatility in chemical reactivity and potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₄H₁₆O₃S₂

InChI: InChI=1/C14H16O3S2/c1-3-8-18-14-11-9(6-5-7-10(11)15)12(19-14)13(16)17-4-2/h3H,1,4-8H2,2H3

SMILES: C=CCSc1c2c(CCCC2=O)c(C(=O)OCC)s1

Synonyms:

• Ethyl 4-Oxo-3-(Prop-2-En-1-Ylsulfanyl)-4,5,6,7-Tetrahydro-2-Benzothiophene-1-Carboxylate

ethyl 3-(allylthio)-4-oxo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate

CAS: 172516-32-4

ethyl 3-(allylthio)-4-oxo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate

Purity: ≥95%

Molecular weight: 296.41g/mol

Ref: 54-OR25324