CAS 172531-37-2

{2-[2-(2-azidoethoxy)ethoxy]ethoxy}acetic acid

Description:

{2-[2-(2-azidoethoxy)ethoxy]ethoxy}acetic acid, with the CAS number 172531-37-2, is a chemical compound characterized by its complex structure, which includes multiple ethoxy groups and an azido functional group. This compound is likely to exhibit properties typical of both carboxylic acids and azides, such as solubility in polar solvents and potential reactivity due to the presence of the azide group. The ethoxy groups contribute to its hydrophilicity, enhancing its solubility in aqueous environments. The azido group may provide opportunities for further chemical modifications or reactions, particularly in click chemistry applications. Additionally, the presence of the carboxylic acid moiety suggests that it can participate in acid-base reactions, potentially acting as a weak acid. Overall, this compound may be of interest in various fields, including medicinal chemistry and materials science, due to its unique functional groups and potential for further derivatization.

Formula: C₈H₁₅N₃O₅

InChI: InChI=1/C8H15N3O5/c9-11-10-1-2-14-3-4-15-5-6-16-7-8(12)13/h1-7H2,(H,12,13)

SMILES: C(COCCOCCOCC(=O)O)N=[N+]=[NH-]

11-Azido-3,6,9-trioxaundecanoic Acid

CAS: 172531-37-2

Formula: C₈H₁₅N₃O₅

Purity: >97.0%(T)

Color and Shape: Light yellow to Brown clear liquid

Molecular weight: 233.22

Ref: 3B-A2293

11-Azido-3,6,9-trioxaundecanoic Acid

CAS: 172531-37-2

Formula: C₈H₁₅N₃O₅

Purity: 95%

Color and Shape: Liquid

Molecular weight: 233.2218

Ref: IN-DA0032NY

11-Azido-3,6,9-Trioxaundecanoic Acid

CAS: 172531-37-2

11-Azido-3,6,9-Trioxaundecanoic Acid

Purity: 95%

Molecular weight: 233.22g/mol

Ref: 54-OR1023649

11-Azido-3,6,9-trioxaundecanoic acid

CAS: 172531-37-2

11-Azido-3,6,9-trioxaundecanoic acid is a glycan that is expressed by cancer cells. Cancer cells are able to produce 11-azido-3,6,9-trioxaundecanoic acid in response to a variety of stimuli. The compound has been shown to be an immunogenic antigen for the generation of antibodies against cancer cells. Lectins can be used to detect glycosylated proteins and glycoconjugates on cell surfaces and can also be used to immobilize them. Immobilized lectins have been used as an alternative method of detecting glycolipids and glycoconjugates on cell surfaces with high sensitivity and specificity. This glycan has been conjugated with cetuximab to target colon cancer cells. Cetuximab is a monoclonal antibody that binds specifically to the epidermal growth factor receptor (EGFR) found on the surface of many colorectal

Formula: C₈H₁₅N₃O₅

Purity: (¹H-Nmr) Min. 95 Area-%

Color and Shape: Clear Liquid

Molecular weight: 233.22 g/mol

Ref: 3D-FA34888

11-carboxy-1-(diazyn-1-ium-1-yl)-4,7,10-trioxa-1-azaundecan-1-ide

CAS: 172531-37-2

Purity: 95%

Color and Shape: Liquid

Molecular weight: 233.223999

Ref: 10-F862353

N3-PEG3-CH2COOH

CAS: 172531-37-2

N3-PEG3-CH2COOH (PROTAC Linker 14) is a PEG-based compound employed in PROTAC synthesis.

Formula: C₈H₁₅N₃O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 233.22

Ref: TM-T16660