CAS 172531-37-2: {2-[2-(2-azidoethoxy)ethoxy]ethoxy}acetic acid

Description:{2-[2-(2-azidoethoxy)ethoxy]ethoxy}acetic acid, with the CAS number 172531-37-2, is a chemical compound characterized by its complex structure, which includes multiple ethoxy groups and an azido functional group. This compound is likely to exhibit properties typical of both carboxylic acids and azides, such as solubility in polar solvents and potential reactivity due to the presence of the azide group. The ethoxy groups contribute to its hydrophilicity, enhancing its solubility in aqueous environments. The azido group may provide opportunities for further chemical modifications or reactions, particularly in click chemistry applications. Additionally, the presence of the carboxylic acid moiety suggests that it can participate in acid-base reactions, potentially acting as a weak acid. Overall, this compound may be of interest in various fields, including medicinal chemistry and materials science, due to its unique functional groups and potential for further derivatization.

Formula:C₈H₁₅N₃O₅

InChI:InChI=1/C8H15N3O5/c9-11-10-1-2-14-3-4-15-5-6-16-7-8(12)13/h1-7H2,(H,12,13)

Found 6 products.

Product data	Purity	Price range	Estimated delivery
11-Azido-3,6,9-trioxaundecanoic Acid REF: 3B-A2293CAS: 172531-37-2	>97.0%(T)	290.00 €	Mon 07 Apr 25
11-Azido-3,6,9-trioxaundecanoic Acid REF: IN-DA0032NYCAS: 172531-37-2	95%	To inquire	Mon 14 Apr 25
11-Azido-3,6,9-Trioxaundecanoic Acid REF: 54-OR1023649CAS: 172531-37-2	95%	257.00 €~1,167.00 €	Tue 15 Apr 25
N3-PEG3-CH2COOH REF: TM-T16660CAS: 172531-37-2	98%	To inquire	Tue 15 Apr 25
11-carboxy-1-(diazyn-1-ium-1-yl)-4,7,10-trioxa-1-azaundecan-1-ide REF: 10-F862353CAS: 172531-37-2	97%	75.00 €~1,469.00 €	Thu 17 Apr 25
11-Azido-3,6,9-trioxaundecanoic acid REF: 3D-FA34888CAS: 172531-37-2	(¹H-Nmr) Min. 95 Area-%	66.00 €~1,014.00 €	Fri 25 Apr 25