CAS 172542-26-6

(S)-[4-(3,4-Methylenedioxy)-phenyl]-2-propanol

Description:

(S)-[4-(3,4-Methylenedioxy)-phenyl]-2-propanol, identified by its CAS number 172542-26-6, is a chiral organic compound characterized by its specific stereochemistry, which is crucial for its biological activity. This compound features a phenyl ring substituted with a methylenedioxy group, enhancing its potential for interactions with biological targets. The presence of the hydroxyl (-OH) group on the propanol moiety contributes to its polarity, influencing its solubility in polar solvents and its reactivity in various chemical reactions. The methylenedioxy group is known to enhance the compound's ability to engage in π-π stacking interactions, which can be significant in drug design and development. Additionally, the stereochemistry of the compound may affect its pharmacokinetics and pharmacodynamics, making it important in medicinal chemistry. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting specific biological pathways.

Formula: C₁₀H₁₂O₃

InChI: InChI=1/C10H12O3/c1-7(11)4-8-2-3-9-10(5-8)13-6-12-9/h2-3,5,7,11H,4,6H2,1H3/t7-/m0/s1

SMILES: C[C@@H](Cc1ccc2c(c1)OCO2)O

Synonyms:

• 172542-26-6
• (2S)-1-(1,3-benzodioxol-5-yl)propan-2-ol

(2S)-1-(1,3-Dioxaindan-5-yl)propan-2-ol

Controlled Product

CAS: 172542-26-6

Versatile small molecule scaffold

Formula: C₁₀H₁₂O₃

Purity: Min. 95%

Molecular weight: 180.2 g/mol

Ref: 3D-XGA54226