CAS 172596-62-2

5-Chloro-1-methyl-1H-indole-3-carboxylic acid

Description:

5-Chloro-1-methyl-1H-indole-3-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chlorine atom at the 5-position and a carboxylic acid group at the 3-position contributes to its unique reactivity and potential applications. This compound typically appears as a solid and is soluble in polar solvents, reflecting its functional groups. It is often used in organic synthesis and medicinal chemistry due to its ability to serve as a building block for more complex molecules. The presence of the methyl group at the 1-position can influence its biological activity and interaction with various biological targets. Additionally, the compound may exhibit specific properties such as acidity, which can be attributed to the carboxylic acid group, and its reactivity can be modulated by the chlorine substituent. Overall, 5-Chloro-1-methyl-1H-indole-3-carboxylic acid is of interest in research for its potential pharmacological applications and as a synthetic intermediate.

Formula: C₁₀H₈ClNO₂

InChI: InChI=1S/C10H8ClNO2/c1-12-5-8(10(13)14)7-4-6(11)2-3-9(7)12/h2-5H,1H3,(H,13,14)

InChI key: InChIKey=CDFMDRWHWBBKJX-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(N(C)C1)=CC=C(Cl)C2

Synonyms:

• 5-Chloro-1-methyl-3-indolecarboxylic acid
• 5-Chloro-1-methyl-1H-indole-3-carboxylic acid
• 1H-Indole-3-carboxylic acid, 5-chloro-1-methyl-

5-Chloro-1-methyl-1H-indole-3-carboxylic acid

Controlled Product

CAS: 172596-62-2

Versatile small molecule scaffold

Formula: C₁₀H₈ClNO₂

Purity: Min. 95%

Molecular weight: 209.63 g/mol

Ref: 3D-XGA59662