CAS 17260-67-2
:2-Chloro-N-methylbenzenesulphonamide
Description:
2-Chloro-N-methylbenzenesulphonamide, with the CAS number 17260-67-2, is an organic compound characterized by the presence of a sulphonamide functional group, a chlorine atom, and a methyl group attached to a benzene ring. This compound typically appears as a solid and is soluble in polar organic solvents. Its structure features a sulfonyl group (–SO2) bonded to a nitrogen atom, which is further connected to a methyl group and a chlorinated aromatic ring. The chlorine substituent can influence the compound's reactivity and biological activity, making it of interest in various chemical and pharmaceutical applications. 2-Chloro-N-methylbenzenesulphonamide may exhibit antibacterial properties and is often studied for its potential use in medicinal chemistry. Safety data indicates that, like many sulphonamides, it should be handled with care due to potential toxicity and environmental impact. Proper storage and disposal methods are essential to mitigate any risks associated with this compound.
Formula:C7H8ClNO2S
InChI:InChI=1/C7H8ClNO2S/c1-9-12(10,11)7-5-3-2-4-6(7)8/h2-5,9H,1H3
SMILES:CNS(=O)(=O)c1ccccc1Cl
Synonyms:- 2-chloro-N-methylbenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Chloro-N-methylbenzenesulfonamide
CAS:Formula:C7H8ClNO2SColor and Shape:SolidMolecular weight:205.66192-Chloro-N-methylbenzenesulphonamide
CAS:2-Chloro-N-methylbenzenesulphonamide
Color and Shape:SolidMolecular weight:205.66g/mol

