CAS 17261-28-8
:2-(Diphenylphosphino)benzoic acid
Description:
2-(Diphenylphosphino)benzoic acid, with the CAS number 17261-28-8, is an organophosphorus compound characterized by the presence of both a benzoic acid moiety and a diphenylphosphino group. This compound typically appears as a solid and is known for its role as a ligand in coordination chemistry, particularly in the formation of metal complexes. The diphenylphosphino group provides strong donor properties, making it useful in catalysis and organic synthesis. The benzoic acid component contributes to its acidity and potential for hydrogen bonding, which can influence its reactivity and solubility in various solvents. Additionally, this compound may exhibit interesting electronic properties due to the conjugation between the aromatic rings and the phosphorus atom. Its applications often extend to fields such as organometallic chemistry and materials science, where it can facilitate the development of novel catalysts or functional materials. Overall, 2-(Diphenylphosphino)benzoic acid is a versatile compound with significant implications in both academic research and industrial applications.
Formula:C19H15O2P
InChI:InChI=1S/C19H15O2P/c20-19(21)17-13-7-8-14-18(17)22(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H,(H,20,21)
InChI key:InChIKey=UYRPRYSDOVYCOU-UHFFFAOYSA-N
SMILES:P(C1=C(C(O)=O)C=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- (2-Carboxyphenyl)diphenylphosphine
- 2-(Diphenylphosphanyl)Benzoic Acid
- Benzoic acid, 2-(diphenylphosphino)-
- Benzoic acid, o-(diphenylphosphino)-
- DPPBac
- o-(Diphenylphosphino)benzoic acid
- 2-(Diphenylphosphino)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-(Diphenylphosphino)benzoic Acid
CAS:Formula:C19H15O2PPurity:>98.0%(GC)(T)Color and Shape:White to Yellow powder to crystalMolecular weight:306.302-(Diphenylphosphino)benzoic acid, min. 97%
CAS:2-(Diphenylphosphino)benzoic acid, min. 97%
Formula:(C6H5)2P(C6H5COOH)Purity:min. 97%Color and Shape:white to yellow solidMolecular weight:306.302-(Diphenylphosphino)benzoic acid
CAS:Formula:C19H15O2PPurity:97%Color and Shape:SolidMolecular weight:306.29502-(Diphenylphosphino)benzoic acid
CAS:2-(Diphenylphosphino)benzoic acidPurity:98%Molecular weight:306.30g/mol2-(Diphenylphosphino)benzoic acid
CAS:Formula:C19H15O2PPurity:97%Color and Shape:Solid, Crystalline Powder or PowderMolecular weight:306.3012-(Diphenylphosphino)benzoic Acid
CAS:Controlled ProductApplications 2-(Diphenylphosphino)benzoic Acid is used in small molecule control of protein function through staudinger reduction.
References Luo, J., et al.: Nat. Chem., 8, 1027 (2016)Formula:C19H15O2PColor and Shape:NeatMolecular weight:306.29





