CAS 17261-34-6
:iminodi(methylphosphonic acid)
Description:
Iminodi(methylphosphonic acid), with the CAS number 17261-34-6, is a chemical compound characterized by its structure, which includes two methylphosphonic acid groups linked by an imino (-NH-) group. This compound is a phosphonic acid derivative, exhibiting properties typical of phosphonic acids, such as strong acidity and the ability to form stable complexes with metal ions. It is soluble in water, making it useful in various applications, including as a reagent in organic synthesis and in the study of biochemical processes. The presence of the imino group contributes to its reactivity, allowing for potential interactions with nucleophiles. Iminodi(methylphosphonic acid) is of interest in environmental chemistry and toxicology, particularly due to its structural similarity to certain chemical warfare agents, which has led to research into its degradation pathways and potential impacts on health and the environment. Overall, this compound serves as a significant subject of study in both synthetic and applied chemistry contexts.
Formula:C2H9NO6P2
InChI:InChI=1/C2H9NO6P2/c4-10(5,6)1-3-2-11(7,8)9/h3H,1-2H2,(H2,4,5,6)(H2,7,8,9)
SMILES:C(NCP(=O)(O)O)P(=O)(O)O
Synonyms:- Iminobis(Methylphosphonic Acid)
- (Iminodimethanediyl)Bis(Phosphonic Acid)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Iminodi(methylphosphonic acid)
CAS:Iminodi(methylphosphonic acid)Purity:97%+Molecular weight:205.04g/molIminodi(methylphosphonic acid)
CAS:Iminodi(methylphosphonic acid) is an acidic, hydroxyl-containing organic compound. It is a polyvalent, nitrogen containing compound and can be used as a specific ligand for metal ions. Iminodi(methylphosphonic acid) has been shown to react with metal surfaces and can be protonated by amines or organic acids. Iminodi(methylphosphonic acid) has calcium-dependent cytosolic activity, which may be due to its ability to form hydrogen bonds with proteins in the cell membrane.
Formula:C2H9NO6P2Purity:Min. 95%Molecular weight:205.04 g/molRef: 3D-SAA26134
Discontinued product




