
CAS 172618-05-2
:1H-Indole-1-carboxamide, 6-chloro-3-[(4-chloro-2-thienyl)hydroxymethylene]-5-fluoro-2,3-dihydro-2-oxo-, (Z)-
Description:
1H-Indole-1-carboxamide, 6-chloro-3-[(4-chloro-2-thienyl)hydroxymethylene]-5-fluoro-2,3-dihydro-2-oxo-, (Z)-, with CAS number 172618-05-2, is a synthetic organic compound characterized by its complex structure, which includes an indole moiety, a carboxamide functional group, and multiple halogen and thienyl substituents. This compound typically exhibits properties associated with indole derivatives, such as potential biological activity, including antimicrobial or anticancer effects, due to the presence of the indole ring, which is known for its role in various biological systems. The presence of chlorine and fluorine atoms may enhance its lipophilicity and influence its interaction with biological targets. The (Z)-configuration indicates a specific geometric arrangement around the double bond, which can affect the compound's reactivity and biological activity. Overall, this compound is of interest in medicinal chemistry and pharmacology, particularly for its potential therapeutic applications. However, detailed studies would be necessary to fully elucidate its properties and biological effects.
Formula:C14H7Cl2FN2O3S
InChI:InChI=1S/C14H7Cl2FN2O3S/c15-5-1-10(23-4-5)12(20)11-6-2-8(17)7(16)3-9(6)19(13(11)21)14(18)22/h1-4,20H,(H2,18,22)/b12-11-
InChI key:InChIKey=RQPSIRZEVZUYOF-QXMHVHEDSA-N
SMILES:C(\O)(=C\1/C=2C(N(C(N)=O)C1=O)=CC(Cl)=C(F)C2)/C3=CC(Cl)=CS3
Synonyms:- CP 100829
- 1H-Indole-1-carboxamide, 6-chloro-3-[(4-chloro-2-thienyl)hydroxymethylene]-5-fluoro-2,3-dihydro-2-oxo-, (Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
CP-100829
CAS:<p>CP-100829 is a bio-active chemical.</p>Formula:C14H7Cl2FN2O3SColor and Shape:SolidMolecular weight:373.19
