CAS 17264-94-7: Benzoic acid, 3-amino-, sodium salt (1:1)
Description:Benzoic acid, 3-amino-, sodium salt (1:1), commonly referred to as sodium 3-aminobenzoate, is a chemical compound characterized by its structure, which includes a benzoic acid moiety with an amino group at the meta position and a sodium ion. This compound is typically a white to off-white solid that is soluble in water, making it useful in various applications, including pharmaceuticals and as a food preservative. The presence of the amino group imparts basic properties, allowing it to act as a buffer in certain chemical reactions. Its sodium salt form enhances its solubility and stability in aqueous solutions. The compound is known for its mild antimicrobial properties, which contribute to its use in food preservation. Additionally, it may serve as an intermediate in organic synthesis and in the production of dyes and other chemical derivatives. Safety data indicates that while it is generally regarded as safe, appropriate handling and usage guidelines should be followed to minimize any potential risks.
Formula:C7H7NO2·Na
InChI:InChI=1S/C7H7NO2.Na/c8-6-3-1-2-5(4-6)7(9)10;/h1-4H,8H2,(H,9,10);
InChI key:InChIKey=OOYSSNNCRLBWDA-UHFFFAOYSA-N
SMILES:[Na].O=C(O)C=1C=CC=C(N)C1
- Synonyms:
- 3-Aminobenzoic acid sodium salt
- Benzoic acid, 3-amino-, monosodium salt
- Benzoic acid, 3-amino-, sodium salt (1:1)
- Benzoic acid, m-amino-, monosodium salt
- Sodium 3-Aminobenzoate
- Sodium m-aminobenzoate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-AMINOBENZOIC ACID SODIUM SALT REF: IN-DA003IX9CAS: 17264-94-7 | 98% | 31.00 €~587.00 € | Thu 27 Mar 25 |
![]() | Sodium 3-aminobenzoate REF: 10-F753779CAS: 17264-94-7 | 97% | - - - | Discontinued product |
![]() | Sodium 3-Aminobenzoate REF: 3D-SAA26494CAS: 17264-94-7 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA003IX9
5g | 74.00 € |

Ref: 10-F753779
5g | Discontinued | Request information | |
25g | Discontinued | Request information |

Sodium 3-Aminobenzoate
Ref: 3D-SAA26494
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information | |
250g | Discontinued | Request information |