CAS 17265-62-2

4-Bromo-5-isothiazolemethanol

Description:

4-Bromo-5-isothiazolemethanol is a chemical compound characterized by its isothiazole ring structure, which is a five-membered heterocyclic compound containing both sulfur and nitrogen. This substance typically exhibits antimicrobial properties, making it useful in various applications, including as a biocide in industrial and agricultural settings. The presence of the bromine atom enhances its reactivity and potential for biological activity. In terms of physical properties, it is generally a solid at room temperature, with solubility in polar solvents due to the hydroxymethyl group. The compound's reactivity can be attributed to the electrophilic nature of the bromine and the functional groups present, allowing it to participate in various chemical reactions. Safety considerations are important, as it may pose risks if not handled properly, including potential toxicity to aquatic organisms. Overall, 4-Bromo-5-isothiazolemethanol is a versatile compound with significant applications in the field of chemistry and materials science.

Formula: C₄H₄BrNOS

InChI: InChI=1S/C4H4BrNOS/c5-3-1-6-8-4(3)2-7/h1,7H,2H2

InChI key: InChIKey=GNHSCDYOGJIADB-UHFFFAOYSA-N

SMILES: C(O)C1=C(Br)C=NS1

Synonyms:

• 4-Bromo-5-isothiazolemethanol
• 5-Isothiazolemethanol, 4-bromo-
• (4-Bromo-1,2-thiazol-5-yl)methanol

(4-Bromo-1,2-thiazol-5-yl)methanol

CAS: 17265-62-2

Versatile small molecule scaffold

Formula: C₄H₄BrNOS

Purity: Min. 95%

Molecular weight: 194.05 g/mol

Ref: 3D-SAA26562