CAS 17266-45-4

(5-bromo-1-benzothiophen-3-yl)acetic acid

Description:

(5-Bromo-1-benzothiophen-3-yl)acetic acid is an organic compound characterized by its unique structure, which includes a benzothiophene moiety substituted with a bromine atom and an acetic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the bromine substituent. The benzothiophene structure contributes to its aromatic character, while the carboxylic acid group enhances its polarity and solubility in polar solvents. The presence of the bromine atom may also influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, compounds like this one can exhibit biological activity, making them of interest in medicinal chemistry and drug development. Its specific applications and behavior in chemical reactions would depend on the context of its use, including the conditions under which it is synthesized or applied.

Formula: C₁₀H₇BrO₂S

InChI: InChI=1/C10H7BrO2S/c11-7-1-2-9-8(4-7)6(5-14-9)3-10(12)13/h1-2,4-5H,3H2,(H,12,13)

SMILES: c1cc2c(cc1Br)c(CC(=O)O)cs2

2-(5-Bromo-1-benzothiophen-3-yl)acetic acid

CAS: 17266-45-4

Versatile small molecule scaffold

Formula: C₁₀H₇BrO₂S

Purity: Min. 95%

Molecular weight: 271.13 g/mol

Ref: 3D-SAA26645