CAS 17266-64-7

1H-Pyrrolizin-1-one,2,3-dihydro-(6CI,7CI,8CI,9CI)

Description:

1H-Pyrrolizin-1-one, 2,3-dihydro- (CAS 17266-64-7) is a bicyclic organic compound characterized by its pyrrolizine structure, which consists of a five-membered ring fused to a six-membered ring. This compound features a carbonyl group (C=O) at the 1-position of the pyrrolizine ring, contributing to its reactivity and potential applications in organic synthesis. The dihydro designation indicates the presence of two additional hydrogen atoms, suggesting that the compound is in a reduced form compared to its fully unsaturated counterparts. 1H-Pyrrolizin-1-one derivatives are of interest in medicinal chemistry due to their biological activity, including potential antitumor and antimicrobial properties. The compound's stereochemistry, denoted by the CI (Chemical Index) designations, indicates specific configurations at certain carbon centers, which can influence its chemical behavior and interactions. Overall, 1H-Pyrrolizin-1-one, 2,3-dihydro- is a compound of interest for further research in various fields, including pharmaceuticals and agrochemicals.

Formula: C₇H₇NO

InChI: InChI=1/C7H7NO/c9-7-3-5-8-4-1-2-6(7)8/h1-2,4H,3,5H2

SMILES: c1cc2C(=O)CCn2c1

Synonyms:

• 3H-1,2-dihydro-1-pyrrolizinone
• 2,3-dihydro-1H-pyrrolizin-1-one

2,3-Dihydro-1H-pyrrolizine-1-one

Controlled Product

CAS: 17266-64-7

Formula: C₇H₇NO

Color and Shape: Neat

Molecular weight: 121.14

Ref: TR-D449795