CAS 17267-46-8: (2S,3R)-2-(Dimethylamino)-1,3-octadecanediol
Description:(2S,3R)-2-(Dimethylamino)-1,3-octadecanediol, with CAS number 17267-46-8, is a chiral compound characterized by its long hydrocarbon chain, which contributes to its amphiphilic nature. This substance features a dimethylamino group, which imparts basic properties and enhances its solubility in polar solvents. The presence of hydroxyl groups at the 1 and 3 positions of the octadecane backbone allows for hydrogen bonding, making it more soluble in water compared to purely hydrophobic compounds. Its stereochemistry, indicated by the (2S,3R) configuration, suggests specific spatial arrangements that can influence its biological activity and interactions with other molecules. This compound is often studied for its potential applications in pharmaceuticals, surfactants, and as a biochemical agent due to its ability to interact with lipid membranes and proteins. Overall, its unique structural features make it a subject of interest in various fields, including medicinal chemistry and materials science.
Formula:C20H43NO2
InChI:InChI=1S/C20H43NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(18-22)21(2)3/h19-20,22-23H,4-18H2,1-3H3/t19-,20+/m0/s1
InChI key:InChIKey=BYBHBTCYJMUUDZ-VQTJNVASSA-N
SMILES:OCC(N(C)C)C(O)CCCCCCCCCCCCCCC
- Synonyms:
- (2S,3R)-2-(Dimethylamino)-1,3-octadecanediol
- 1,3-Octadecanediol, 2-(dimethylamino)-, [R-(R*,S*)]-
- 1,3-Octadecanediol, 2-(dimethylamino)-, (2S,3R)-
- 1,3-Octadecanediol, 2-(dimethylamino)-, D-erythro-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | N,N-dimethyl Sphinganine (d18:0) REF: TM-T36987CAS: 17267-46-8 | - - - | 94.00 €~394.00 € | Mon 21 Apr 25 |
![]() | N,N-dimethyl Sphinganine (d18:0) REF: 48-56-1401CAS: 17267-46-8 | >95% | 103.00 € | Mon 21 Apr 25 |
![]() | N,N-Dimethyl-D-erythro-dihydrosphingosine REF: 3D-SAA26746CAS: 17267-46-8 | Min. 95% | - - - | Discontinued product |

N,N-dimethyl Sphinganine (d18:0)
Ref: TM-T36987
5mg | 94.00 € | ||
10mg | 170.00 € | ||
25mg | 394.00 € |

N,N-dimethyl Sphinganine (d18:0)
Ref: 48-56-1401
10mg | 103.00 € |

N,N-Dimethyl-D-erythro-dihydrosphingosine
Ref: 3D-SAA26746
100mg | Discontinued | Request information |