CAS 172670-07-4
:[2-methyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] propanoate
Description:
[2-methyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] propanoate, with the CAS number 172670-07-4, is a chemical compound characterized by its complex structure, which includes a propanoate ester linked to an aromatic system. This compound features a 2-methyl group and an amino-substituted phenyl ring, which contributes to its potential biological activity. The presence of the phenylpyrazole moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates it may exhibit properties such as lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the compound may participate in various chemical reactions due to the functional groups present, including potential hydrogen bonding and electrophilic or nucleophilic reactivity. Overall, the characteristics of this compound suggest it could have applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation through experimental studies.
Formula:C19H19N3O2
InChI:InChI=1/C19H19N3O2/c1-3-19(23)24-17-10-9-15(13-14(17)2)20-18-11-12-22(21-18)16-7-5-4-6-8-16/h4-13H,3H2,1-2H3,(H,20,21)
Synonyms:- 2-methyl-4-[(1-phenyl-1H-pyrazol-3-yl)amino]phenyl propanoate
- FPL 64170XX
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
FPL-64170XX
CAS:FPL-64170XX is a selective inhibitor of the enzyme 5-lipoxygenase.Formula:C19H19N3O2Color and Shape:SolidMolecular weight:321.37
