CAS 172673-23-3
:3H-1,2,4-Triazol-3-one, 5-[[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)-4-oxido-4-morpholinyl]methyl]-1,2-dihydro-, [2R-[2α(R*),3α]]-
Description:
3H-1,2,4-Triazol-3-one, with the CAS number 172673-23-3, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This specific derivative features a complex substituent that includes a morpholine moiety and multiple aromatic groups, including a trifluoromethyl-substituted phenyl and a fluorophenyl group. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to interact with biological targets. The trifluoromethyl group often enhances lipophilicity and metabolic stability, while the morpholine ring can contribute to the compound's solubility and binding properties. Additionally, the compound may exhibit interesting biological activities, making it a candidate for further research in drug discovery. Its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as chromatography. Overall, this compound represents a class of triazole derivatives that are of significant interest in various fields, including agrochemicals and pharmaceuticals.
Formula:C23H21F7N4O4
InChI:InChI=1S/C23H21F7N4O4/c1-12(14-8-15(22(25,26)27)10-16(9-14)23(28,29)30)38-20-19(13-2-4-17(24)5-3-13)34(36,6-7-37-20)11-18-31-21(35)33-32-18/h2-5,8-10,12,19-20H,6-7,11H2,1H3,(H2,31,32,33,35)/t12-,19+,20-,34?/m1/s1
InChI key:InChIKey=CXAQOLFUIZCJSQ-FMSQANQXSA-N
SMILES:C(N1(=O)[C@H]([C@@H](O[C@H](C)C2=CC(C(F)(F)F)=CC(C(F)(F)F)=C2)OCC1)C3=CC=C(F)C=C3)C=4NC(=O)NN4
Synonyms:- 3H-1,2,4-Triazol-3-one, 5-[[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)-4-oxido-4-morpholinyl]methyl]-1,2-dihydro-, [2R-[2α(R*),3α]]-
- 3H-1,2,4-Triazol-3-one, 5-[[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)-4-morpholinyl]methyl]-1,2-dihydro-, N-oxide, [2R-[2α(R*),3α]]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Aprepitant N-Oxide
CAS:Controlled ProductFormula:C23H21F7N4O4Color and Shape:NeatMolecular weight:550.426Aprepitant-d4 N-Oxide
CAS:Controlled ProductFormula:C23H17D4F7N4O4Color and Shape:NeatMolecular weight:554.45


