CAS 172695-22-6

3-N-BOC-(S)-AMINO BUTYRONITRILE

Description:

3-N-BOC-(S)-Amino Butyronitrile, with the CAS number 172695-22-6, is a chemical compound characterized by its structure, which includes a butyronitrile moiety and a tert-butyloxycarbonyl (BOC) protecting group on the amino function. This compound is typically used in organic synthesis, particularly in the preparation of amino acids and peptides. The BOC group serves as a protective group for the amine, allowing for selective reactions without affecting the amino functionality. The presence of the nitrile group contributes to its reactivity, making it a valuable intermediate in various synthetic pathways. The (S) designation indicates that the compound has a specific stereochemistry, which is crucial in biological applications where chirality can influence the activity of the resulting molecules. Overall, 3-N-BOC-(S)-Amino Butyronitrile is an important building block in medicinal chemistry and pharmaceutical development, facilitating the synthesis of more complex structures.

Formula: C₉H₁₆N₂O₂

InChI: InChI=1/C9H16N2O2/c1-7(5-6-10)11-8(12)13-9(2,3)4/h7H,5H2,1-4H3,(H,11,12)/t7-/m0/s1

SMILES: C[C@@H](CC#N)N=C(O)OC(C)(C)C

Synonyms:

• Carbamic acid, [(1S)-2-cyano-1-methylethyl]-, 1,1-dimethylethyl ester (9CI)
• tert-butyl [(1S)-2-cyano-1-methylethyl]carbamate

3-N-BOC-(S)-AMINO BUTYRONITRILE

CAS: 172695-22-6

Formula: C₉H₁₆N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 184.2355

Ref: IN-DA00AB24

Tert-butyl (S)-(1-cyanopropan-2-yl)carbamate

CAS: 172695-22-6

Tert-butyl (S)-(1-cyanopropan-2-yl)carbamate

Purity: 95%

Molecular weight: 184.24g/mol

Ref: 54-OR92748

(S)-tert-Butyl (1-cyanopropan-2-yl)carbamate

CAS: 172695-22-6

Purity: 95%

Molecular weight: 184.23899841308594

Ref: 10-F437973