CAS 172695-33-9
:Fmoc-L-beta-homovaline
Description:
Fmoc-L-beta-homovaline is a synthetic amino acid derivative characterized by the presence of a fluorenylmethyloxycarbonyl (Fmoc) protecting group, which is commonly used in peptide synthesis to protect the amino group of the amino acid. This compound features a beta-homovaline structure, which is an analog of valine with an additional carbon in the side chain, contributing to its unique properties. The Fmoc group allows for selective deprotection under mild basic conditions, facilitating the stepwise assembly of peptides. Fmoc-L-beta-homovaline is typically utilized in the field of peptide chemistry, particularly in the synthesis of peptides with specific structural or functional characteristics. Its hydrophobic side chain can influence the folding and stability of peptides, making it valuable in the design of bioactive compounds. Additionally, the compound is generally stable under standard laboratory conditions but should be handled with care, following appropriate safety protocols. As with many synthetic amino acids, its applications extend to research in drug development, biochemistry, and molecular biology.
Formula:C21H23NO4
InChI:InChI=1/C21H23NO4/c1-13(2)19(11-20(23)24)22-21(25)26-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18-19H,11-12H2,1-2H3,(H,22,25)(H,23,24)/t19-/m1/s1
SMILES:CC(C)[C@@H](CC(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12
Synonyms:- Fmoc-Beta-Hoval-Oh
- Fmoc-Beta-Homoval-Oh
- Fmoc-L-Beta-Leucine
- Fmoc-Val-(C*Ch2)Oh
- (R)-3-(Fmoc-Amino)-4-Methylpentanoic Acid
- (R)-3-(9h-Fluoren-9-Ylmethoxycarbonylamino)-4-Methyl-Pentanoic Acid
- (R)-N-Beta-(9-Fluorenylmethoxycarbonyl)-3-Amino-4-Methyl Pentanoic Acid
- (R)-N-Fmoc-3-Amino-4-Methylpentanoic Acid
- (3R)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid
- Fmoc-β-HoVal-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Fmoc-L-β-homovaline, 95%
CAS:N-Fmoc-L-beta-homovaline is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU referen
Formula:C21H23NO4Purity:95%Molecular weight:353.42(3R)-3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4-methylpentanoic acid
CAS:Formula:C21H23NO4Purity:98%Color and Shape:SolidMolecular weight:353.4116Fmoc-ß-HoVal-OH
CAS:M06117 - Fmoc-ß-HoVal-OH
Formula:C21H23NO4Purity:98%Color and Shape:SolidMolecular weight:353.418




