CAS 17274-12-3

2,3,5-triiodobenzoic acid sodium

Description:

2,3,5-Triiodobenzoic acid sodium, with the CAS number 17274-12-3, is a sodium salt of a triiodinated benzoic acid. This compound is characterized by the presence of three iodine atoms attached to the benzene ring at the 2, 3, and 5 positions, which significantly enhances its hydrophobicity and alters its reactivity compared to non-iodinated benzoic acids. The sodium salt form indicates that it is soluble in water, making it useful in various applications, including as a reagent in organic synthesis and in biological studies. The presence of iodine also imparts unique properties, such as increased X-ray attenuation, which can be advantageous in medical imaging. Additionally, this compound may exhibit biological activity, potentially influencing metabolic pathways or serving as a tracer in biochemical research. Overall, 2,3,5-triiodobenzoic acid sodium is notable for its structural features, solubility, and potential applications in both scientific research and medical fields.

Formula: C₇H₂I₃NaO₂

InChI: InChI=1/C7H3I3O2.Na/c8-3-1-4(7(11)12)6(10)5(9)2-3;/h1-2H,(H,11,12);/q;+1/p-1

SMILES: c1c(cc(c(c1C(=O)O)I)I)I.[Na]

Synonyms:

• 2,3,5-Triiodobenzoic acid, sodium salt
• Sodium 2,3,5-Triiodobenzoate

2,3,5-Triiodobenzoic acid, sodium salt

CAS: 17274-12-3

2,3,5-Triiodobenzoic acid, sodium salt

Molecular weight: 521.79g/mol

Ref: 54-BIT3070