CAS 172753-42-3

2-(dimethylamino)-4-oxo-1H-quinoline-3-carbaldehyde

Description:

2-(Dimethylamino)-4-oxo-1H-quinoline-3-carbaldehyde, with the CAS number 172753-42-3, is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a dimethylamino group, contributing to its basicity and potential for forming hydrogen bonds, which can influence its reactivity and solubility in various solvents. The presence of the aldehyde functional group indicates that it can participate in condensation reactions and may act as a reactive electrophile. Additionally, the keto group enhances the compound's stability and can participate in tautomeric equilibria. This compound is of interest in medicinal chemistry and may exhibit biological activity, making it a candidate for further research in drug development. Its properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods, and safety data should be consulted for handling and usage in laboratory settings.

Formula: C₁₂H₁₂N₂O₂

InChI: InChI=1/C12H12N2O2/c1-14(2)12-9(7-15)11(16)8-5-3-4-6-10(8)13-12/h3-7H,1-2H3,(H,13,16)

SMILES: CN(C)c1c(C=O)c(c2ccccc2n1)O

2-(Dimethylamino)-4-oxo-1,4-dihydroquinoline-3-carbaldehyde

CAS: 172753-42-3

2-(Dimethylamino)-4-oxo-1,4-dihydroquinoline-3-carbaldehyde

Purity: ≥95%

Molecular weight: 216.24g/mol

Ref: 54-OR322389