CAS 17278-28-3
:isocucurbitacin B
Description:
Isocucurbitacin B is a naturally occurring compound classified as a cucurbitacin, which is a type of tetracyclic triterpenoid. It is primarily derived from various plants in the Cucurbitaceae family, such as cucumbers and gourds. This compound is known for its bitter taste and has been studied for its potential pharmacological properties, including anti-cancer, anti-inflammatory, and anti-microbial activities. Isocucurbitacin B exhibits a complex molecular structure characterized by multiple rings and functional groups, contributing to its biological activity. It is typically found in low concentrations in plant sources, which may limit its direct application in therapeutic contexts. Additionally, due to its bitter nature, it may serve as a natural deterrent against herbivory in plants. Research into isocucurbitacin B continues to explore its mechanisms of action and potential uses in medicine, particularly in the field of oncology. However, further studies are necessary to fully understand its efficacy and safety in clinical applications.
Formula:C32H46O8
InChI:InChI=1/C32H46O8/c1-17(33)40-27(2,3)13-12-23(36)32(9,39)25-21(35)15-29(6)22-11-10-18-19(14-20(34)26(38)28(18,4)5)31(22,8)24(37)16-30(25,29)7/h10,12-13,19,21-22,25-26,35,38-39H,11,14-16H2,1-9H3/b13-12+/t19-,21-,22+,25-,26-,29+,30-,31+,32+/m1/s1
InChI key:InChIKey=WTBZNVRBNJWSPF-DZEACCAPSA-N
SMILES:C[C@]12[C@@](C)([C@@]([C@@](C(/C=C/C(OC(C)=O)(C)C)=O)(C)O)([C@H](O)C1)[H])CC(=O)[C@]3(C)[C@]2(CC=C4[C@]3(CC(=O)[C@@H](O)C4(C)C)[H])[H]
Synonyms:- (1S,4R,9beta,16alpha,17alpha,23E)-1,16,20-trihydroxy-9,10,14-trimethyl-2,11,22-trioxo-4,9-cyclo-9,10-secocholesta-5,23-dien-25-yl acetate
- (1S,4R,9beta,16alpha,23E)-1,16,20-trihydroxy-9,10,14-trimethyl-2,11,22-trioxo-4,9-cyclo-9,10-secocholesta-5,23-dien-25-yl acetate
- (3α,9β,10α,16α,23E)-25-(Acetyloxy)-3,16,20-trihydroxy-9-methyl-19-norlanosta-5,23-diene-2,11,22-trione
- 19-Norlanosta-5,23-diene-2,11,22-trione, 25-(acetyloxy)-3,16,20-trihydroxy-9-methyl-, (3alpha,9beta,10alpha,16alpha,23E)-
- 19-Norlanosta-5,23-diene-2,11,22-trione, 25-(acetyloxy)-3,16,20-trihydroxy-9-methyl-, (3α,9β,10α,16α,23E)-
- 2-Epicucurbiticin B
- Cucurbitcin B, 2-Epi-
- Nsc 106400
- epi-Isocucurbitacin B
- Isocucurbitacin B
- (3alpha,9beta,10alpha,16alpha,23E)-25-(Acetyloxy)-3,16,20-trihydroxy-9-methyl-19-norlanosta-5,23-diene-2,11,22-trione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Isocucurbitacin B
CAS:Isocucurbitacin B has significant activities against HeLa and HT-29 human cancer cells with IC50 values ranging from 0.93 to 9.73uM.Formula:C32H46O8Purity:99.84%Color and Shape:SolidMolecular weight:558.7Isocucurbitacin B
CAS:Isocucurbitacin B has significantly activities against HeLa and HT-29 human cancer cells with IC50 values ranging from 0.93 to 9.73uM.Formula:C32H46O8Purity:95%~99%Molecular weight:558.712Isocucurbitacin B
CAS:Controlled ProductIsocucurbitacin B is a triterpenoid saponin that has cytotoxic and anticancer properties. It has been shown to inhibit the growth of cancer cells in vivo, as well as to induce apoptosis in vitro. Isocucurbitacin B also inhibits the proliferation of human colon cancer cells by inducing G1 cell cycle arrest and apoptosis. The compound has been found to be chemically stable and does not react with other chemical substances. Isocucurbitacin B is used as a pharmaceutical preparation for animals, but not humans.Formula:C32H46O8Purity:Min. 95%Molecular weight:558.7 g/mol





