CAS 17283-14-6
:3,4-Dimethylphenethylamine
Description:
3,4-Dimethylphenethylamine, with the CAS number 17283-14-6, is an organic compound belonging to the class of phenethylamines. It features a phenethylamine backbone, which consists of a phenyl ring attached to an ethylamine chain, with two methyl groups located at the 3 and 4 positions of the aromatic ring. This structural arrangement contributes to its unique chemical properties. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential psychoactive effects and has been studied for its role in various biochemical pathways. As a secondary amine, it can participate in hydrogen bonding, influencing its solubility in polar and non-polar solvents. The compound's reactivity may include interactions typical of amines, such as alkylation and acylation. Due to its structural similarity to other biologically active compounds, it may exhibit stimulant properties, although specific pharmacological effects can vary. Safety and handling precautions are essential, as with many amines, due to potential toxicity and reactivity.
Formula:C10H15N
InChI:InChI=1/C10H15N/c1-8-3-4-10(5-6-11)7-9(8)2/h3-4,7H,5-6,11H2,1-2H3
SMILES:Cc1ccc(CCN)cc1C
Synonyms:- 2-(3,4-Dimethylphenyl)Ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.