CAS 172876-96-9
:1,2-Benziodoxole-1(3H)-carbonitrile,3-oxo
Description:
1,2-Benziodoxole-1(3H)-carbonitrile, 3-oxo, identified by its CAS number 172876-96-9, is a chemical compound that features a unique structure combining a benziodoxole moiety with a carbonitrile and a ketone functional group. This compound is characterized by its heterocyclic ring system, which contributes to its reactivity and potential applications in organic synthesis. The presence of the carbonitrile group indicates that it can participate in nucleophilic reactions, while the ketone functionality may allow for further transformations, such as condensation or oxidation reactions. Additionally, the benziodoxole structure is known for its stability and ability to act as an electrophile, making it useful in various chemical reactions, including those involving oxidation. Overall, this compound is of interest in the field of synthetic organic chemistry, particularly for its potential utility in the development of new synthetic methodologies and the synthesis of complex organic molecules.
Formula:C8H4INO2
InChI:InChI=1/C8H4INO2/c10-5-9-7-4-2-1-3-6(7)8(11)12-9/h1-4H
SMILES:c1ccc2c(c1)C(=O)OI2C#N
Synonyms:- 7-Oxo-9$L^{3}-Ioda-8-Oxabicyclo[4.3.0]Nona-1,3,5-Triene-9-Carbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,2-BENZIODOXOLE-1(3H)-CARBONITRILE
CAS:Formula:C8H4INO2Purity:95%Color and Shape:SolidMolecular weight:273.02733-Oxo-1,2-benziodoxole-1(3H)-carbonitrile
CAS:3-Oxo-1,2-benziodoxole-1(3H)-carbonitrileFormula:C8H4INO2Purity:99%Color and Shape: white solidMolecular weight:273.03g/mol1,2-Benziodoxole-1(3H)-carbonitrile, 3-oxo-
CAS:Formula:C8H4INO2Purity:95%Color and Shape:SolidMolecular weight:273.0291,2-Benziodoxole-1(3H)-carbonitrile, 3-oxo-
CAS:1,2-Benziodoxole-1(3H)-carbonitrile, 3-oxo- is a chemical compound that can be used as a solvent and as a reagent in organic synthesis. It is soluble in nonpolar solvents such as benzene or toluene. It can also be used for the preparation of p-toluenesulfonic acid by reacting with boron trifluoride etherate and nitrous acid. 1,2-Benziodoxole-1(3H)-carbonitrile, 3-oxo-, is an impurity in the synthesis of 1,4-benzodioxanone and 4,4'-diphenyl ether. This compound may also be used to synthesize dinitrobenzene by reacting with ammonia under acidic conditions.Formula:C8H4INO2Purity:Min. 95%Molecular weight:273.03 g/mol



