
CAS 172889-30-4
:[4,5′-Bi-1H-pyrazol]-3(2H)-one, 3′,5-dimethyl-1′,2-diphenyl-
Description:
[4,5′-Bi-1H-pyrazol]-3(2H)-one, 3′,5-dimethyl-1′,2-diphenyl- is a chemical compound characterized by its unique pyrazole structure, which consists of two pyrazole rings connected by a carbonyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry. The presence of dimethyl and diphenyl substituents contributes to its hydrophobic character and may influence its reactivity and interaction with biological targets. The compound's molecular structure suggests potential applications in pharmaceuticals, particularly in the development of anti-inflammatory or anticancer agents. Additionally, its stability and reactivity can be influenced by the electronic effects of the substituents, which may affect its synthesis and functional properties. Overall, this compound represents a class of pyrazole derivatives that are valuable for further research in various chemical and biological applications.
Formula:C20H18N4O
InChI:InChI=1S/C20H18N4O/c1-14-13-18(23(21-14)16-9-5-3-6-10-16)19-15(2)22-24(20(19)25)17-11-7-4-8-12-17/h3-13,22H,1-2H3
InChI key:InChIKey=MBZINFISJNLCQJ-UHFFFAOYSA-N
SMILES:O=C1C(C=2N(N=C(C)C2)C3=CC=CC=C3)=C(C)NN1C4=CC=CC=C4
Synonyms:- [4,5′-Bi-1H-pyrazol]-3(2H)-one, 3′,5-dimethyl-1′,2-diphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
