CAS 17289-61-1
:METHYL-BETA-D-RIBOPYRANOSE
Description:
Methyl-beta-D-ribopyranose is a monosaccharide derivative, specifically a methyl glycoside of ribose, which is a five-carbon sugar (pentose) that plays a crucial role in biological systems, particularly in the structure of RNA. This compound features a pyranose ring, which is a six-membered cyclic structure formed by the reaction of the aldehyde group of ribose with one of its hydroxyl groups. The "beta" designation indicates the configuration of the hydroxyl group at the anomeric carbon, which is oriented in the same direction as the CH2OH group at the fifth carbon. Methyl-beta-D-ribopyranose is typically a white crystalline solid and is soluble in water due to its hydroxyl groups, which can form hydrogen bonds with water molecules. It is used in various biochemical applications, including as a building block in the synthesis of nucleosides and nucleotides. Additionally, it may serve as a model compound in studies of carbohydrate chemistry and enzymatic reactions involving ribose derivatives.
Formula:C6H12O5
InChI:InChI=1/C6H12O5/c1-10-6-5(9)4(8)3(7)2-11-6/h3-9H,2H2,1H3
SMILES:COC1C(C(C(CO1)O)O)O
Synonyms:- beta.-D-Ribopyranoside, methyl
- Methylb-D-ribopyranoside
- Methyl Pentopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl β-D-ribopyranoside
CAS:<p>Methyl β-D-ribopyranoside is a sugar alcohol that belongs to the group of pentoses. It is a potential precursor for the synthesis of phosphite, which is a reactive anion used in organic chemistry. Methyl β-D-ribopyranoside has been shown to regulate the growth of bacteria and fungi by altering their metabolic pathways. This compound also has shown to be programmed death in certain bacterial strains, although it is not clear how it induces this programmed death. Methyl β-D-ribopyranoside can also affect the rhizosphere and can be used as a substrate for anions and sugar alcohols.</p>Formula:C6H12O5Purity:Min. 99 Area-%Color and Shape:White PowderMolecular weight:164.16 g/mol
