CAS 1729-02-8: ethyl 8-methoxy-2-oxo-2H-chromene-3-carboxylate
Description:Ethyl 8-methoxy-2-oxo-2H-chromene-3-carboxylate, with the CAS number 1729-02-8, is a chemical compound belonging to the class of chromenes, which are characterized by a fused benzene and pyran ring structure. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a methoxy group at the 8-position enhances its electron-donating properties, potentially influencing its reactivity and interaction with biological systems. The 2-oxo group indicates the presence of a carbonyl functionality, which can participate in various chemical reactions, including condensation and nucleophilic addition. Ethyl 8-methoxy-2-oxo-2H-chromene-3-carboxylate may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Overall, this compound exemplifies the diverse chemistry associated with chromene derivatives, which are known for their varied biological and chemical properties.
Formula:C13H12O5
InChI:InChI=1/C13H12O5/c1-3-17-12(14)9-7-8-5-4-6-10(16-2)11(8)18-13(9)15/h4-7H,3H2,1-2H3
- Synonyms:
- 2H-1-benzopyran-3-carboxylic acid, 8-methoxy-2-oxo-, ethyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2H-1-Benzopyran-3-carboxylic acid, 8-methoxy-2-oxo-, ethyl ester REF: IN-DA00HZLLCAS: 1729-02-8 | - - - | To inquire | Thu 17 Apr 25 |
![]() | Ethyl 8-methoxycoumarin-3-carboxylate REF: 54-OR351035CAS: 1729-02-8 | - - - | To inquire | Mon 21 Apr 25 |
![]() | Ethyl 8-methoxy-2-oxo-2H-chromene-3-carboxylate REF: 10-F725233CAS: 1729-02-8 | 95+% | - - - | Discontinued product |
![]() | Ethyl 8-methoxy-2-oxo-2H-chromene-3-carboxylate REF: 3D-BAA72902CAS: 1729-02-8 | Min. 95% | - - - | Discontinued product |

2H-1-Benzopyran-3-carboxylic acid, 8-methoxy-2-oxo-, ethyl ester
Ref: IN-DA00HZLL
Undefined size | To inquire |

Ethyl 8-methoxy-2-oxo-2H-chromene-3-carboxylate
Ref: 10-F725233
1g | Discontinued | Request information |

Ethyl 8-methoxy-2-oxo-2H-chromene-3-carboxylate
Ref: 3D-BAA72902
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |