CAS 17290-70-9
:Isosinensetin
Description:
Isosinensetin, with the CAS number 17290-70-9, is a naturally occurring flavonoid belonging to the class of compounds known as methoxyflavones. It is primarily found in various plants, particularly in citrus species. Isosinensetin is characterized by its complex structure, which includes multiple hydroxyl and methoxy groups that contribute to its biological activity. This compound exhibits a range of pharmacological properties, including antioxidant, anti-inflammatory, and potential anticancer effects, making it of interest in medicinal chemistry and nutraceutical research. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in formulations. Additionally, isosinensetin's interaction with various biological targets is an area of ongoing research, as it may influence cellular signaling pathways and contribute to health benefits associated with dietary flavonoids. Overall, isosinensetin represents a significant compound in the study of plant-derived substances and their potential therapeutic applications.
Formula:C20H20O7
InChI:InChI=1S/C20H20O7/c1-22-13-7-6-11(8-15(13)23-2)14-9-12(21)18-16(24-3)10-17(25-4)19(26-5)20(18)27-14/h6-10H,1-5H3
InChI key:InChIKey=UYCWETIUOAGWIL-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=C(OC)C(OC)=C1)OC(=CC2=O)C3=CC(OC)=C(OC)C=C3
Synonyms:- 3′,4′,5,7,8-Pentamethoxyflavone
- 2-(3,4-Dimethoxyphenyl)-5,7,8-trimethoxy-4H-1-benzopyran-4-one
- Isosinensetin
- 4H-1-Benzopyran-4-one, 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxy-
- Flavone, 3′,4′,5,7,8-pentamethoxy-
- 5,7,8,3',4'-Pentamethoxyflavone
- 3',4',5,7,8-pentamethoxyflavon
- 4'-Pentamethoxyflavone
- 3',4' ,5,7,8-pentaMethoxyflavone
- 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one
- 2-(3,4-Dimethoxyphenyl)-5,7,8-trimethoxy-4H-chromen-4-one
- 6-Demethoxynobiletin
- 6-Demethoxylnobiletin
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Isosinensetin
CAS:Isosinensetin shows antioxidant and HIV-1 protease inhibiting activities.Formula:C20H20O7Purity:95%~99%Molecular weight:372.373Isosinensetin
CAS:1. Isosinensetin (6-Demethoxynobiletin) shows antioxidant and HIV-1 protease inhibiting activities.Formula:C20H20O7Purity:99.98% - ≥95%Color and Shape:SolidMolecular weight:372.37Ref: TM-T2S0223
1mg63.00€5mg135.00€10mg195.00€25mg326.00€50mg485.00€100mg700.00€1mL*10mM (DMSO)165.00€2-(3,4-Dimethoxyphenyl)-5,7,8-trimethoxy-4H-chromen-4-one
CAS:Formula:C20H20O7Purity:≥98%Molecular weight:372.373Isosinensetin
CAS:Isosinensetin is a polymethoxyflavone, which is a type of flavonoid compound. It is primarily sourced from citrus fruits, particularly those belonging to the genus Citrus, such as oranges and tangerines. The compound's mode of action is largely attributed to its various biochemical interactions, such as modulation of signaling pathways, antioxidant activity, and potential anti-inflammatory effects. These actions may influence cellular processes, contributing to its health-promoting properties.
Formula:C20H20O7Purity:Min. 95%Color and Shape:PowderMolecular weight:372.37 g/mol






