CAS 172902-25-9
:2-(4-chloro-6-methyl-pyrimidin-2-yl)phenol
Description:
2-(4-chloro-6-methyl-pyrimidin-2-yl)phenol, with the CAS number 172902-25-9, is a chemical compound characterized by its unique structure, which includes a phenolic group and a pyrimidine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the hydroxyl (-OH) group on the phenol moiety. The chlorinated pyrimidine component contributes to its biological activity, making it of interest in pharmaceutical and agrochemical research. The presence of the methyl group on the pyrimidine ring can influence its solubility and interaction with biological targets. Additionally, this compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 2-(4-chloro-6-methyl-pyrimidin-2-yl)phenol is a compound of interest due to its potential applications in various fields, including medicinal chemistry and material science.
Formula:C11H9ClN2O
InChI:InChI=1/C11H9ClN2O/c1-7-6-10(12)14-11(13-7)8-4-2-3-5-9(8)15/h2-6,15H,1H3
SMILES:Cc1cc(Cl)nc(c2ccccc2O)n1
Synonyms:- 2-(4-Chloro-6-methylpyrimidin-2-yl)phenol
- Phenol, 2-(4-chloro-6-methyl-2-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
