CAS 172939-67-2
:3-O-Benzoyl-N-acetyl-a-D-galactosaminyl-1-O-N-(Fmoc)serine Phenacylester
Description:
3-O-Benzoyl-N-acetyl-α-D-galactosaminyl-1-O-N-(Fmoc)serine phenacyl ester is a complex organic compound that features a combination of functional groups, making it significant in biochemical applications, particularly in glycosylation and peptide synthesis. The presence of the benzoyl and phenacyl ester groups indicates that it has potential for use in protecting group strategies during organic synthesis. The N-acetyl-α-D-galactosamine moiety suggests that this compound may play a role in carbohydrate chemistry, particularly in the study of glycoproteins or glycolipids. The Fmoc (9-fluorenylmethoxycarbonyl) group is commonly used as a protective group for amines in peptide synthesis, allowing for selective deprotection under mild conditions. Overall, this compound's structure suggests it may be utilized in the synthesis of glycopeptides or other bioactive molecules, contributing to research in medicinal chemistry and biochemistry. Its specific properties, such as solubility and reactivity, would depend on the surrounding conditions and the presence of other reagents.
Formula:C41H40N2O12
InChI:InChI=1/C41H40N2O12/c1-24(45)42-35-37(55-38(48)26-14-6-3-7-15-26)36(47)34(20-44)54-40(35)52-22-32(39(49)51-23-33(46)25-12-4-2-5-13-25)43-41(50)53-21-31-29-18-10-8-16-27(29)28-17-9-11-19-30(28)31/h2-19,31-32,34-37,40,44,47H,20-23H2,1H3,(H,42,45)(H,43,50)/t32-,34?,35?,36-,37?,40-/m0/s1
SMILES:CC(=NC1C([C@H](C(CO)O[C@@H]1OC[C@@H](C(=O)OCC(=O)c1ccccc1)N=C(O)OCC1c2ccccc2c2ccccc12)O)OC(=O)c1ccccc1)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-O-Benzoyl-N-acetyl-alpha-D-galactosaminyl-1-O-N-(Fmoc)serine Phenacylester
CAS:Controlled ProductApplications A useful glycopeptide intermediate.
Formula:C41H40N2O12Color and Shape:NeatMolecular weight:752.762-Acetamido-3-O-benzoyl-2-deoxy-a-D-galactopyranosyl Fmoc serine phenacyl ester
CAS:2-Acetamido-3-O-benzoyl-2-deoxy-a-D-galactopyranosyl Fmoc serine phenacyl ester is a complex carbohydrate. It is an oligosaccharide with a molecular weight of 902 Da that is synthesized from 2,4,6,-trihydroxybenzoic acid and 2,3,4,6,-tetraacetylphenylserine. The carbohydrate has been modified by methylation, glycosylation and fluorination. The synthesis of this compound has been carried out using the click chemistry reaction. This product has a purity of 99+% and can be used in the modification of other carbohydrates.
Formula:C41H40N2O12Purity:Min. 95%Molecular weight:752.78 g/mol


