CAS 17296-28-5
:2-BIPHENYL-(2'-METHOXY)CARBOXYLIC ACID
Description:
2-Biphenyl-(2'-methoxy)carboxylic acid, with the CAS number 17296-28-5, is an organic compound characterized by its biphenyl structure substituted with a methoxy group and a carboxylic acid functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively low reactivity under standard conditions. The presence of the methoxy group can influence its solubility, making it more soluble in organic solvents compared to water. The carboxylic acid group contributes to its acidic nature, allowing it to participate in various chemical reactions, including esterification and acid-base reactions. Additionally, the compound may exhibit biological activity, which can be of interest in pharmaceutical applications. Its molecular structure suggests potential uses in organic synthesis and as an intermediate in the production of more complex molecules. Overall, 2-biphenyl-(2'-methoxy)carboxylic acid is a versatile compound with properties that make it relevant in both industrial and research settings.
Formula:C14H12O3
InChI:InChI=1/C14H12O3/c1-17-13-9-5-4-7-11(13)10-6-2-3-8-12(10)14(15)16/h2-9H,1H3,(H,15,16)
SMILES:COc1ccccc1c1ccccc1C(=O)O
Synonyms:- [1,1'-Biphenyl]-2-carboxylic acid, 2'-methoxy-
- 2'-Methoxybiphenyl-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(2-Methoxyphenyl)benzoic acid
CAS:Formula:C14H12O3Purity:97%Color and Shape:SolidMolecular weight:228.24332'-Methoxybiphenyl-2-carboxylic acid
CAS:<p>2'-Methoxybiphenyl-2-carboxylic acid is a benzene carboxylic acid that is used as a precursor for biphenyl-2-carboxylic acids. 2'-Methoxybiphenyl-2-carboxylic acid can be synthesized by refluxing 2'-hydroxybiphenyl with peroxides in the presence of benzene, followed by cyclisation and decarboxylation. Alternatively, 2'-methoxybiphenyl-2-carboxylic acid can be obtained by thermally decomposing 3,4,5,6-tetramethylbenzoic acid. This compound has been shown to react intramolecularly and intermediacy with triphenylene to form triphenyltetracarboxylic acids.</p>Formula:C14H12O3Purity:Min. 95%Molecular weight:228.25 g/mol


