CAS 17298-58-7
:5'-methylthioinosine
Description:
5'-Methylthioinosine (MTI) is a purine nucleoside derivative characterized by the presence of a methylthio group at the 5' position of the ribose sugar. It is a naturally occurring compound that plays a role in various biochemical processes, particularly in the metabolism of purines. MTI is involved in the regulation of cellular functions and has been studied for its potential effects on cellular signaling pathways. The compound is soluble in water and exhibits stability under physiological conditions, making it relevant for biological studies. Its structure consists of an inosine base linked to a ribose sugar, with the methylthio group contributing to its unique properties. MTI is often investigated in the context of its role in cellular metabolism and its potential therapeutic applications, particularly in relation to its effects on energy metabolism and cell signaling. As a research compound, it is important for understanding the complex interactions within cellular systems and may have implications in various fields, including biochemistry and pharmacology.
Formula:C11H14N4O4S
InChI:InChI=1/C11H14N4O4S/c1-20-2-5-7(16)8(17)11(19-5)15-4-14-6-9(15)12-3-13-10(6)18/h3-5,7-8,11,16-17H,2H2,1H3,(H,12,13,18)/t5-,7-,8-,11-/m1/s1
Synonyms:- Inosine, 5'-S-methyl-5'-thio-
- 5-Dmti
- 5'-Methylthioinosine
- 5'-S-methyl-5'-thioinosinato
- 5'-Deoxy-5'-methylthioinosine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5'-Methylthioinosine
CAS:5'-Methylthioinosine is a useful organic compound for research related to life sciences. The catalog number is T125589 and the CAS number is 17298-58-7.Formula:C11H14N4O4SColor and Shape:SolidMolecular weight:298.32
