CAS 17298-80-5

(4Z)-2-oxohex-4-enoic acid

Description:

(4Z)-2-oxohex-4-enoic acid, also known as 4-oxo-4-hexenoic acid, is an organic compound characterized by its unique structure, which includes a conjugated double bond and a ketone functional group. This compound features a six-carbon chain with a carboxylic acid group at one end and a ketone group at the fourth carbon, contributing to its reactivity and potential applications in organic synthesis. The "4Z" designation indicates the specific geometric configuration of the double bond, which can influence its chemical behavior and interactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is soluble in polar solvents, making it useful in various chemical reactions, including those involving nucleophiles. Its reactivity can be attributed to the presence of both the carbonyl and the double bond, allowing it to participate in addition reactions, polymerization, and other transformations. Overall, (4Z)-2-oxohex-4-enoic acid is of interest in fields such as organic chemistry and materials science.

Formula: C₆H₈O₃

InChI: InChI=1/C6H8O3/c1-2-3-4-5(7)6(8)9/h2-3H,4H2,1H3,(H,8,9)/b3-2-

SMILES: C/C=C\CC(=O)C(=O)O

Synonyms:

• XGNKMQBCAVIQOR-IHWYPQMZSA-N
• 2-Oxo-cis-4-hexenoic Acid
• 4-Hexenoic acid, 2-oxo-, (4Z)-

2-Oxo-cis-4-hexenoic Acid

Controlled Product

CAS: 17298-80-5

Formula: C₆H₈O₃

Color and Shape: Neat

Molecular weight: 128.126

Ref: TR-O870130