CAS 172986-25-3
:1-[7-Bromo-5-(2-chlorophenyl)-2,3-dihydro-2-oxo-1H-1,4-benzodiazepin-3-yl] butanedioate
Description:
1-[7-Bromo-5-(2-chlorophenyl)-2,3-dihydro-2-oxo-1H-1,4-benzodiazepin-3-yl] butanedioate, with the CAS number 172986-25-3, is a chemical compound that belongs to the benzodiazepine class, characterized by its complex structure which includes a benzodiazepine core fused with a butanedioate moiety. This compound typically exhibits properties such as moderate to high lipophilicity due to the presence of aromatic rings, which can influence its solubility and bioavailability. The bromine and chlorine substituents contribute to its unique reactivity and potential biological activity. Benzodiazepines are often known for their pharmacological effects, including anxiolytic, sedative, and anticonvulsant properties, although the specific biological activity of this compound would require empirical investigation. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in medicinal chemistry for the development of new therapeutic agents. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.
Formula:C19H14BrClN2O5
InChI:InChI=1S/C19H14BrClN2O5/c20-10-5-6-14-12(9-10)17(11-3-1-2-4-13(11)21)23-19(18(27)22-14)28-16(26)8-7-15(24)25/h1-6,9,19H,7-8H2,(H,22,27)(H,24,25)
InChI key:InChIKey=NQTRBZXDWMDXAQ-UHFFFAOYSA-N
SMILES:ClC1=C(C=2C=3C(NC(=O)C(OC(CCC(O)=O)=O)N2)=CC=C(Br)C3)C=CC=C1
Synonyms:- Butanedioic acid, 1-[7-bromo-5-(2-chlorophenyl)-2,3-dihydro-2-oxo-1H-1,4-benzodiazepin-3-yl] ester
- Butanedioic acid, mono[7-bromo-5-(2-chlorophenyl)-2,3-dihydro-2-oxo-1H-1,4-benzodiazepin-3-yl] ester
- 1-[7-Bromo-5-(2-chlorophenyl)-2,3-dihydro-2-oxo-1H-1,4-benzodiazepin-3-yl] butanedioate
- Cinazepam
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Cinazepam
CAS:<p>Cinazepam is a GABAA receptor partial agonist and a benzodiazepine derivative with anxiolytic and sedative properties. Cinazepam can be utilized in research related to sleep disorders.</p>Formula:C19H14BrClN2O5Color and Shape:SolidMolecular weight:465.68

