CAS 1730-24-1

1,4-Pentadiene, 1-bromo-1,2-difluoro-

Description:

1,4-Pentadiene, 1-bromo-1,2-difluoro- is an organic compound characterized by its structure, which includes a five-carbon chain with two double bonds (pentadiene) and specific halogen substituents. The presence of bromine and fluorine atoms introduces unique reactivity and physical properties. This compound is likely to be a colorless to pale yellow liquid at room temperature, exhibiting a distinct odor typical of diene compounds. Its molecular structure suggests that it may participate in various chemical reactions, including electrophilic addition and polymerization, due to the presence of the conjugated double bonds. The halogen substituents can also influence its reactivity, making it a potential candidate for further chemical transformations. Additionally, the compound's properties, such as boiling point, melting point, and solubility, would be influenced by the presence of the bromine and fluorine atoms, which can affect intermolecular interactions. Safety considerations are important, as halogenated compounds can pose health risks, necessitating proper handling and storage protocols.

Formula: C₅H₅BrF₂

InChI: InChI=1S/C5H5BrF2/c1-2-3-4(7)5(6)8/h2H,1,3H2

InChI key: InChIKey=JVBBHFCPHKUCMW-UHFFFAOYSA-N

SMILES: C(CC=C)(=C(Br)F)F

Synonyms:

• (1Z)-1-bromo-1,2-difluoropenta-1,4-diene
• 1,4-Pentadiene, 1-bromo-1,2-difluoro-
• 1-Bromo-1,2-Difluoro-1,4-Pentadiene, 95% Min.
• 1-Bromo-1,2-difluoro-penta-1,4-diene
• 1-Bromo-1,2-difluoro-1,4-pentadiene

1-Bromo-1,2-difluoro-1,4-pentadiene

CAS: 1730-24-1

1-Bromo-1,2-difluoro-1,4-pentadiene

Purity: ≥95%

Molecular weight: 182.99g/mol

Ref: 54-PC2649