CAS 1730-37-6
:1-methylfluorene
Description:
1-Methylfluorene is an organic compound characterized by its structure, which consists of a fluorene backbone with a methyl group attached to one of the carbon atoms. It is a polycyclic aromatic hydrocarbon (PAH) and is known for its stability and hydrophobic nature due to the presence of multiple aromatic rings. The compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. 1-Methylfluorene is relatively insoluble in water but soluble in organic solvents such as benzene and toluene. It has applications in organic synthesis and materials science, particularly in the development of organic semiconductors and light-emitting devices. The compound exhibits fluorescence, making it useful in various photonic applications. Additionally, like many PAHs, it may pose environmental and health risks, necessitating careful handling and disposal. Its chemical properties, including reactivity and stability, are influenced by the presence of the methyl group, which can affect its interactions with other chemical species.
Formula:C14H12
InChI:InChI=1/C14H12/c1-10-5-4-8-13-12-7-3-2-6-11(12)9-14(10)13/h2-8H,9H2,1H3
InChI key:InChIKey=GKEUODMJRFDLJY-UHFFFAOYSA-N
SMILES:CC1=C2C(C=3C(C2)=CC=CC3)=CC=C1
Synonyms:- 1-methyl-9H-fluorene
- 9H-Fluorene, 1-methyl-
- 9H-Fluorene, 1-methyl- (9CI)
- Fluorene, 1-methyl-
- Fluorene, 1-methyl- (8CI)
- Nsc 80183
- 1-Methylfluorene
- METHYLFLUORENE
- 1-Methylfluorene 98%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Methylfluorene
CAS:<p>1-Methylfluorene is a colorless liquid that is soluble in water and alcohols. It is used as a monomer to produce polymers, such as poly(vinylidene fluoride) or poly(chlorotrifluoroethylene). 1-Methylfluorene is also used to prepare perfluorocarbon emulsions for use in water vapor permeable membranes which are used in wastewater treatment. 1-Methylfluorene has shown to be an effective inhibitor of human monocytic cells, thp-1 cells. It also binds to the receptor site on the cell membrane, inhibiting the influx of cations and water molecules. This can result in apoptosis, or programmed cell death. The sample preparation for 1-Methylfluorene includes extraction with petroleum ether followed by purification using column chromatography with silica gel and elution with hydrogen chloride acidified methanol.</p>Formula:C14H12Purity:Min. 95%Color and Shape:PowderMolecular weight:180.25 g/mol1-Methylfluorene
CAS:Controlled Product<p>Applications 1-Methylfluorene is a volatile constituent in Greek tobacco and has been found to not have mutagenic activity.<br>References Kimland, B., et. al.: Acta Chem. Scand., 26, 2177 (1972); Rice, J.E., et. al. J. Toxicol. Env. Health, 21, 525 (1987)<br></p>Formula:C14H12Color and Shape:NeatMolecular weight:180.2451



