CAS 17301-09-6: Atropine glucuronide

Description:Atropine glucuronide is a chemical compound that is a metabolite of atropine, an alkaloid derived from plants of the Solanaceae family, such as belladonna. This compound is formed through the conjugation of atropine with glucuronic acid, a process that typically occurs in the liver and facilitates the excretion of drugs and metabolites. Atropine glucuronide is characterized by its role in pharmacokinetics, as it is generally more water-soluble than its parent compound, which aids in renal elimination. The compound is often studied in the context of drug metabolism and pharmacology, particularly regarding the effects of atropine and its derivatives on the nervous system. Atropine itself is known for its anticholinergic properties, affecting neurotransmission by blocking acetylcholine receptors. The presence of glucuronide conjugates like atropine glucuronide can influence the overall pharmacological profile of atropine, including its efficacy and safety. Understanding the characteristics of atropine glucuronide is essential for comprehending the metabolic pathways and potential therapeutic implications of atropine and similar compounds.

Formula:C₂₃H₃₁NO₉

InChI:InChI=1S/C23H31NO9/c1-24-13-7-8-14(24)10-15(9-13)32-22(30)16(12-5-3-2-4-6-12)11-31-23-19(27)17(25)18(26)20(33-23)21(28)29/h2-6,13-20,23,25-27H,7-11H2,1H3,(H,28,29)

InChI key:InChIKey=WIFBYLWEGJIRPO-UHFFFAOYSA-N

SMILES:O=C(O)C1OC(OCC(C(=O)OC2CC3N(C)C(CC3)C2)C=4C=CC=CC4)C(O)C(O)C1O

Synonyms:
α-D-Glucopyranosiduronic acid, 3-[(8-methyl-8-azabicyclo[3.2.1]oct-3-yl)oxy]-3-oxo-2-phenylpropyl, endo-
Atropine 9′-glucuronide
1αH,5αH-Tropan-3α-ol, monoester with β-carboxyphenethyl β-D-glucopyranosiduronic acid
Glucopyranosiduronic acid, β-carboxyphenethyl, mono-1αH,5αH-tropan-3α-yl ester, β-D-
α-D-Glucopyranosiduronic acid, 3-[(endo-8-methyl-8-azabicyclo[3.2.1]oct-3-yl)oxy]-3-oxo-2-phenylpropyl