CAS 17301-22-3

2,5-Dimethylundecane

Description:

2,5-Dimethylundecane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. Its molecular formula is C13H28, indicating it consists of 13 carbon atoms and 28 hydrogen atoms. This compound features two methyl groups attached to the undecane backbone at the 2nd and 5th positions, which contributes to its branched structure. 2,5-Dimethylundecane is typically a colorless liquid at room temperature and exhibits low volatility and a relatively high boiling point compared to straight-chain alkanes of similar molecular weight. It is insoluble in water but soluble in organic solvents, reflecting its hydrophobic nature. The compound is primarily used in research and industrial applications, including as a solvent or in the synthesis of other chemical compounds. Its physical and chemical properties, such as density and viscosity, can vary based on temperature and pressure conditions. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₁₃H₂₈

InChI: InChI=1S/C13H28/c1-5-6-7-8-9-13(4)11-10-12(2)3/h12-13H,5-11H2,1-4H3

InChI key: InChIKey=HGYKYVHHAJFANS-UHFFFAOYSA-N

SMILES: C(CCC(C)C)(CCCCCC)C

Synonyms:

• 2,5-Dimethylundecane
• Undecane, 2,5-dimethyl-

2,5-Dimethylundecane

Controlled Product

CAS: 17301-22-3

Formula: C₁₃H₂₈

Color and Shape: Neat

Molecular weight: 184.361

Ref: TR-D482854