CAS 17303-83-2
:3-Formyl-2-thiopheneboronic acid
Description:
3-Formyl-2-thiopheneboronic acid is an organoboron compound characterized by the presence of both a boronic acid functional group and an aldehyde group attached to a thiophene ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar solvents such as water and alcohols, owing to the presence of the boronic acid moiety. The boronic acid group allows for participation in various chemical reactions, including Suzuki coupling, making it valuable in organic synthesis and materials science. The aldehyde functionality can undergo typical reactions associated with aldehydes, such as condensation and reduction. Additionally, the thiophene ring contributes to the compound's electronic properties, potentially enhancing its reactivity and interactions with other molecules. Overall, 3-Formyl-2-thiopheneboronic acid is a versatile compound with applications in medicinal chemistry, organic synthesis, and the development of functional materials. Its unique structure allows for diverse reactivity, making it a subject of interest in various fields of chemical research.
Formula:C5H5BO3S
InChI:InChI=1S/C5H5BO3S/c7-3-4-1-2-10-5(4)6(8)9/h1-3,8-9H
InChI key:InChIKey=HYXMHAHVUFTVFZ-UHFFFAOYSA-N
SMILES:C(=O)C1=C(B(O)O)SC=C1
Synonyms:- (3-Formyl-2-thienyl)boronic acid
- (3-Formylthiophen-2-Yl)Boronic Acid
- 2-Boronothiophene-3-carboxaldehyde
- 2-Thiopheneboronic acid, 3-formyl-
- 3-Formyl-2-thienylboronic acid
- 3-Formyl-2-thiopheneboronic acid
- B-(3-Formyl-2-thienyl)boronic acid
- Boronic acid, (3-formyl-2-thienyl)-
- Boronic acid, B-(3-formyl-2-thienyl)-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Formyl-2-thiopheneboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C5H5BO3SPurity:97.0 to 113.0 %Color and Shape:White to Orange to Green powder to crystalMolecular weight:155.963-Formylthiophene-2-boronic acid, 97%
CAS:3-Formylthiophene-2-boronic acid is used as reactant for Suzuki-Miyaura cross-coupling reactions. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar prFormula:C5H5BO3SPurity:97%Color and Shape:Crystals or powder or crystalline powder, White to cream or pale yellowMolecular weight:155.96(3-Formyl-2-thienyl)boronic acid
CAS:(3-Formyl-2-thienyl)boronic acidFormula:C5H5BO3SPurity:98%Molecular weight:155.96739Boronic acid, B-(3-formyl-2-thienyl)-
CAS:Formula:C5H5BO3SPurity:95%Color and Shape:SolidMolecular weight:155.9674(3-Formylthiophen-2-yl)boronic acid
CAS:(3-Formylthiophen-2-yl)boronic acidFormula:C5H5BO3SPurity:96%Molecular weight:155.97(3-Formylthiophen-2-yl)boronic acid
CAS:Formula:C5H5BO3SPurity:95%Color and Shape:SolidMolecular weight:155.963-Formyl-2-thienylboronic acid
CAS:3-Formyl-2-thienylboronic acid is an organometallic compound that has a variety of bioactivities. It reacts with boronic acids to form cross-coupled products, which can be used in the synthesis of pharmaceuticals. 3-Formyl-2-thienylboronic acid has been shown to selectively react with a variety of boronic acids and produce highly substituted products. The constant nature of 3-Formyl-2-thienylboronic acid makes it suitable for introducing formyl groups into organic molecules for chemical ligation reactions. This compound is found in nature as an isomeric mixture of two enantiomers: R and S, which are chemically identical but have different biological properties.
Formula:C5H5BO3SPurity:Min. 95%Molecular weight:155.97 g/mol






