CAS 173035-10-4: 1,3-bis(2,4,6-trimethylphenyl)-imidazolidinium-chloride
Description:1,3-bis(2,4,6-trimethylphenyl)-imidazolidinium chloride, with the CAS number 173035-10-4, is an organic compound characterized by its imidazolidinium structure, which features a five-membered ring containing nitrogen atoms. This compound is typically recognized for its role as a photoinitiator in polymerization processes, particularly in the production of coatings, adhesives, and inks. The presence of bulky 2,4,6-trimethylphenyl groups enhances its stability and solubility in various organic solvents, making it effective in initiating polymerization upon exposure to UV light. Additionally, the chloride ion serves as a counterion, contributing to the compound's overall ionic character. Its unique structure allows for efficient energy transfer during the photoinitiation process, leading to rapid curing of materials. Safety considerations should be taken into account, as with many chemical substances, including proper handling and storage to avoid potential hazards. Overall, this compound is significant in the field of materials science and photochemistry due to its functional properties and applications.
Formula:C21H29ClN2
InChI:InChI=1/C21H28N2.ClH/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;/h9-12H,7-8,13H2,1-6H3;1H
- Synonyms:
- 1,3-Bis(2,4,6-trimethylphenyl)-imidazolidinium-chlorid
- 1,3-Bis-(2,4,6-Trimethylphenyl)-4,5-Dihydro-1H-Imidazolium Chloride
- 1,3-Bis-(2,4,6-trimethyl-phenyl)-imidazolidin-1-ium chloride
- 1,3-Bis-(2,4,6-trimethylphenyl)imidazolidinium
- N,Nμ-(2,4,6-Trimethylphenyl)dihydroimidazolium chloride
- 1,3-Bis-(2,4,6-Trimethyl-Phenyl)-4,5-Dihydro-3H-Imidazol-1-Ium Chloride
