CAS 173039-10-6

2-(Phosphonomethyl)pentanedioic acid

Description:

2-(Phosphonomethyl)pentanedioic acid, also known by its CAS number 173039-10-6, is an organophosphorus compound characterized by the presence of both phosphonic acid and dicarboxylic acid functional groups. This compound typically appears as a white to off-white solid and is soluble in water due to its polar functional groups. It has applications in various fields, including agriculture as a herbicide and in the synthesis of other chemical compounds. The presence of the phosphonomethyl group enhances its reactivity and potential for forming chelates with metal ions, which can be beneficial in various chemical processes. Additionally, its structure allows for potential interactions with biological systems, making it of interest in pharmaceutical research. The compound is generally stable under standard conditions but may require careful handling due to its acidic nature and potential reactivity with bases or nucleophiles. Overall, 2-(Phosphonomethyl)pentanedioic acid is a versatile compound with significant implications in both industrial and research applications.

Formula: C₆H₁₁O₇P

InChI: InChI=1S/C6H11O7P/c7-5(8)2-1-4(6(9)10)3-14(11,12)13/h4H,1-3H2,(H,7,8)(H,9,10)(H2,11,12,13)

InChI key: InChIKey=ISEYJGQFXSTPMQ-UHFFFAOYSA-N

SMILES: C(CCC(O)=O)(CP(=O)(O)O)C(O)=O

Synonyms:

• 2-(Phosphonomethyl)pentanedioic acid
• Pentanedioic acid, 2-(phosphonomethyl)-

PMPA(NAALADaseinhibitor)

CAS: 173039-10-6

Formula: C₆H₁₁O₇P

Purity: 95%

Color and Shape: Solid

Molecular weight: 226.1211

Ref: IN-DA00AKR8

2-PMPA

CAS: 173039-10-6

2-PMPA

Purity: ≥95%

Molecular weight: 226.12g/mol

Ref: 54-BUP06519

2-(Phosphonomethyl)Pentanedioic Acid

CAS: 173039-10-6

2-(Phosphonomethyl)Pentanedioic Acid

Purity: 95%

Molecular weight: 226.12g/mol

Ref: 54-OR1023868

2-(Phosphonomethyl)-pentanedioic acid

CAS: 173039-10-6

Formula: C₆H₁₁O₇P

Purity: ≥ 97.0%

Color and Shape: White to off-white powder or solid

Molecular weight: 226.1

Ref: 7W-GM5846

2-PMPA

CAS: 173039-10-6

2-PMPA (2-(Phosphonomethyl)pentanedioic acid) is a potent and selective inhibitor of glutamate carboxypeptidase II (GCPII) (IC50=300 pM).

Formula: C₆H₁₁O₇P

Purity: 97.4% - 99.5%

Color and Shape: Solid

Molecular weight: 226.12

Ref: TM-T3440

2-(Phosphonomethyl)pentanedioic Acid

Controlled Product

CAS: 173039-10-6

Formula: C₆H₁₁O₇P

Color and Shape: Neat

Molecular weight: 226.121

Ref: TR-P353900