CAS 173074-85-6
:2-(5-tetradecenyl)cyclobutanone
Description:
2-(5-Tetradecenyl)cyclobutanone is an organic compound characterized by its unique cyclobutanone structure, which features a four-membered carbon ring with a ketone functional group. The presence of a tetradecenyl side chain indicates that it has a long carbon chain with a double bond, contributing to its unsaturation and potentially influencing its reactivity and physical properties. This compound is likely to be a colorless to pale yellow liquid at room temperature, exhibiting a distinct odor typical of ketones. Its molecular structure suggests it may participate in various chemical reactions, including oxidation and reduction, and could serve as an intermediate in organic synthesis. Additionally, the unsaturated nature of the tetradecenyl group may allow for further functionalization, making it of interest in fields such as materials science and medicinal chemistry. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as temperature and the presence of other chemicals.
Formula:C18H32O
InChI:InChI=1/C18H32O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-15-16-18(17)19/h9-10,17H,2-8,11-16H2,1H3/b10-9-
InChI key:InChIKey=ITFDRFJPWYWSMZ-KTKRTIGZNA-N
SMILES:C(CCC/C=C\CCCCCCCC)C1C(=O)CC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2-(5Z)-5-Tetradecen-1-yl-cyclobutanone
CAS:Controlled ProductFormula:C18H32OColor and Shape:NeatMolecular weight:264.452-(5Z)-5-Tetradecen-1-yl-cyclobutanone-D17
CAS:Controlled ProductFormula:C18D17H15OColor and Shape:NeatMolecular weight:281.551

