CAS 173075-45-1

Ganoderic acid DM

Description:

Ganoderic acid DM is a triterpenoid compound primarily derived from the Ganoderma lucidum mushroom, commonly known as reishi. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups, contributing to its bioactivity. Ganoderic acid DM exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects, making it of interest in both traditional medicine and modern therapeutic research. It is typically studied for its ability to modulate immune responses and promote overall health. The compound is soluble in organic solvents but has limited solubility in water, which can influence its bioavailability and efficacy in biological systems. As research continues, Ganoderic acid DM is being explored for its potential applications in nutraceuticals and pharmaceuticals, highlighting the importance of natural products in drug discovery and development.

Formula: C₃₀H₄₄O₄

InChI: InChI=1S/C30H44O4/c1-18(9-8-10-19(2)26(33)34)20-11-16-30(7)25-21(12-15-29(20,30)6)28(5)14-13-24(32)27(3,4)23(28)17-22(25)31/h10,18,20,23H,8-9,11-17H2,1-7H3,(H,33,34)/b19-10+/t18-,20-,23+,28-,29-,30+/m1/s1

InChI key: InChIKey=ZTKZZRIVAYGFSF-PIPDTRPPSA-N

SMILES: C[C@]12C3=C([C@]4(C)[C@@](CC3=O)(C(C)(C)C(=O)CC4)[H])CC[C@]1(C)[C@@]([C@@H](CC/C=C(/C(O)=O)\C)C)(CC2)[H]

Synonyms:

• (+)-Ganoderic acid DM
• Lanosta-8,24-dien-26-oic acid, 3,7-dioxo-, (24E)-
• Ganoderic acid DM
• (24E)-3,7-Dioxolanosta-8,24-dien-26-oic acid

Ganoderic acid DM

CAS: 173075-45-1

Formula: C₃₀H₄₄O₄

Purity: 97.5%

Molecular weight: 468.6680

Ref: IN-DA00APGS

Ganoderic acid DM

CAS: 173075-45-1

Ganoderic acid DM inhibits osteoclastogenesis, targeting c-Fos, NFATc1, and reducing DC-STAMP expression, thus preventing osteoclast fusion.

Formula: C₃₀H₄₄O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 468.67

Ref: TM-TN1663

Ganoderic acid DM

CAS: 173075-45-1

Formula: C₃₀H₄₄O₄

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 468.678

Ref: BP-SBP00821

Ganoderic acid DM

Controlled Product

CAS: 173075-45-1

Ganoderic acid DM is a specialized triterpenoid compound, which is a bioactive metabolite derived from the Lingzhi mushroom, scientifically known as Ganoderma lucidum. This compound is produced through complex biosynthetic pathways in the fungus, where it is synthesized as part of a family of lanostane triterpenoids, recognized for their diverse pharmacological effects.

Formula: C₃₀H₄₄O₄

Purity: Min. 95%

Molecular weight: 468.67 g/mol

Ref: 3D-FG42657