CAS 17312-72-0
:4,4-DIPROPYLHEPTANE
Description:
4,4-Dipropylheptane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. Its molecular structure consists of a heptane backbone with two propyl groups attached to the fourth carbon atom. This configuration contributes to its unique physical and chemical properties. The compound is typically colorless and has a relatively high boiling point compared to straight-chain alkanes due to its increased molecular weight and branching, which affects its volatility. 4,4-Dipropylheptane is non-polar and hydrophobic, making it insoluble in water but soluble in organic solvents. It is primarily used in research and industrial applications, particularly in the study of hydrocarbon behavior and as a reference compound in various chemical analyses. Safety data indicates that, like many hydrocarbons, it may pose risks such as flammability and potential health hazards upon inhalation or skin contact, necessitating appropriate handling and storage measures. Overall, 4,4-Dipropylheptane serves as an interesting subject for studies in organic chemistry and hydrocarbon properties.
Formula:C13H28
InChI:InChI=1/C13H28/c1-7-9-13(10-8-2,11(3)4)12(5)6/h11-12H,7-10H2,1-6H3
SMILES:CCCC(CCC)(C(C)C)C(C)C
Synonyms:- Heptane,4,4-Dipropyl-
- 4,4-Di(Propan-2-Yl)Heptane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
