CAS 17318-08-0

5-Bromo-1,3-dichloro-2-fluorobenzene

Description:

5-Bromo-1,3-dichloro-2-fluorobenzene is an aromatic halogenated compound characterized by the presence of multiple halogen substituents on a benzene ring. Specifically, it features a bromine atom at the 5-position, two chlorine atoms at the 1 and 3-positions, and a fluorine atom at the 2-position of the benzene ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its relatively low solubility in water but higher solubility in organic solvents, making it useful in various chemical applications. The presence of multiple halogens contributes to its reactivity, particularly in nucleophilic substitution reactions. Additionally, the compound may exhibit biological activity, which can be of interest in pharmaceutical research. Safety precautions should be taken when handling this substance, as halogenated compounds can be toxic and environmentally persistent. Proper storage and disposal methods are essential to mitigate any potential hazards associated with its use.

Formula: C₆H₂BrCl₂F

InChI: InChI=1S/C6H2BrCl2F/c7-3-1-4(8)6(10)5(9)2-3/h1-2H

InChI key: InChIKey=MMJSIYGLDQNUTH-UHFFFAOYSA-N

SMILES: FC1=C(Cl)C=C(Br)C=C1Cl

Synonyms:

• 3,5-Dichloro-4-Fluoro-1-Bromobenzene
• Benzene, 5-bromo-1,3-dichloro-2-fluoro-
• 1-bromo-3,5-dichloro-4-fluorobenzene
• 5-Bromo-1,3-dichloro-2-fluorobenzene

Benzene, 5-bromo-1,3-dichloro-2-fluoro-

CAS: 17318-08-0

Formula: C₆H₂BrCl₂F

Purity: 97%

Color and Shape: Solid

Molecular weight: 243.8885

Ref: IN-DA001YOQ

3,5-Dichloro-4-fluorobromobenzene

CAS: 17318-08-0

3,5-Dichloro-4-fluorobromobenzene

Formula: C₆H₂BrCl₂F

Purity: ≥95%

Color and Shape: clear. colourless liquid

Molecular weight: 243.89g/mol

Ref: 54-PC8928

5-Bromo-1,3-dichloro-2-fluorobenzene

CAS: 17318-08-0

Formula: C₆H₂BrCl₂F

Purity: 98.0%

Color and Shape: Low Melting Solid

Molecular weight: 243.88

Ref: 10-F035887